EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H21NO2 |
| Net Charge | 0 |
| Average Mass | 259.349 |
| Monoisotopic Mass | 259.15723 |
| SMILES | CCOC(=O)[C@@]1(c2ccccc2)CCC=C[C@@H]1NC |
| InChI | InChI=1S/C16H21NO2/c1-3-19-15(18)16(13-9-5-4-6-10-13)12-8-7-11-14(16)17-2/h4-7,9-11,14,17H,3,8,12H2,1-2H3/t14-,16+/m0/s1 |
| InChIKey | PDJZPNKVLDWEKI-GOEBONIOSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | NMDA receptor antagonist Any substance that inhibits the action of N-methyl-D-aspartate (NMDA) receptors. They tend to induce a state known as dissociative anesthesia, marked by catalepsy, amnesia, and analgesia, while side effects can include hallucinations, nightmares, and confusion. Due to their psychotomimetic effects, many NMDA receptor antagonists are used as recreational drugs. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1R,2S)-nortilidine (CHEBI:77841) has role drug metabolite (CHEBI:49103) |
| (1R,2S)-nortilidine (CHEBI:77841) has role NMDA receptor antagonist (CHEBI:60643) |
| (1R,2S)-nortilidine (CHEBI:77841) is a ethyl 2-(methylamino)-1-phenylcyclohex-3-ene-1-carboxylate (CHEBI:77835) |
| (1R,2S)-nortilidine (CHEBI:77841) is enantiomer of (1S,2R)-nortilidine (CHEBI:77839) |
| Incoming Relation(s) |
| rac-nortilidine (CHEBI:77829) has part (1R,2S)-nortilidine (CHEBI:77841) |
| (1S,2R)-nortilidine (CHEBI:77839) is enantiomer of (1R,2S)-nortilidine (CHEBI:77841) |
| IUPAC Name |
|---|
| ethyl (1R,2S)-2-(methylamino)-1-phenylcyclohex-3-ene-1-carboxylate |
| Synonyms | Source |
|---|---|
| (1R,2S)-(−)-nortilidine | ChEBI |
| ethyl trans-(−)-2-(methylamino)-1-phenyl-3-cyclohexene-1-carboxylate | ChEBI |
| (−)-nortilidine | ChEBI |