EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H12N2O2 |
| Net Charge | 0 |
| Average Mass | 132.163 |
| Monoisotopic Mass | 132.08988 |
| SMILES | NCCCC(N)C(=O)O |
| InChI | InChI=1S/C5H12N2O2/c6-3-1-2-4(7)5(8)9/h4H,1-3,6-7H2,(H,8,9) |
| InChIKey | AHLPHDHHMVZTML-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chlamydomonas reinhardtii (ncbitaxon:3055) | - | PubMed (25515814) | |
| Daphnia magna (ncbitaxon:35525) | - | Article (Mixtures of similarly acting compounds in Daphnia magna: From gene to metabolite and beyondTine Vandenbrouck, Oliver A.H. Jones, Nathalie Dom, Julian L. Griffin, Wim De CoenEnvironment International 36 (2010) 254-268) | |
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Homo sapiens (ncbitaxon:9606) | - | PubMed (15449570) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. Daphnia magna metabolite A Daphnia metabolite produced by the species Daphnia magna. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ornithine (CHEBI:18257) has role Daphnia magna metabolite (CHEBI:83056) |
| ornithine (CHEBI:18257) has role Escherichia coli metabolite (CHEBI:76971) |
| ornithine (CHEBI:18257) has role algal metabolite (CHEBI:84735) |
| ornithine (CHEBI:18257) has role human metabolite (CHEBI:77746) |
| ornithine (CHEBI:18257) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| ornithine (CHEBI:18257) is conjugate acid of ornithinate (CHEBI:32964) |
| ornithine (CHEBI:18257) is conjugate base of ornithinium(1+) (CHEBI:46912) |
| Incoming Relation(s) |
| eflornithine (CHEBI:41948) has functional parent ornithine (CHEBI:18257) |
| ornithine derivative (CHEBI:25718) has functional parent ornithine (CHEBI:18257) |
| D-ornithine (CHEBI:16176) is a ornithine (CHEBI:18257) |
| L-ornithine (CHEBI:15729) is a ornithine (CHEBI:18257) |
| ornithinium(1+) (CHEBI:46912) is conjugate acid of ornithine (CHEBI:18257) |
| ornithinate (CHEBI:32964) is conjugate base of ornithine (CHEBI:18257) |
| N2-ornithino group (CHEBI:46930) is substituent group from ornithine (CHEBI:18257) |
| N5-ornithino group (CHEBI:46934) is substituent group from ornithine (CHEBI:18257) |
| ornithine residue (CHEBI:46928) is substituent group from ornithine (CHEBI:18257) |
| ornithyl group (CHEBI:46929) is substituent group from ornithine (CHEBI:18257) |
| IUPAC Names |
|---|
| 2,5-diaminopentanoic acid |
| ornithine |
| Synonyms | Source |
|---|---|
| 2,5-Diaminopentanoic acid | KEGG COMPOUND |
| 2,5-Diaminovaleric acid | KEGG COMPOUND |
| DL-Ornithine | ChemIDplus |
| Orn | IUPAC |
| Ornithine | KEGG COMPOUND |
| Citations |
|---|