EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H38O2 |
| Net Charge | 0 |
| Average Mass | 334.544 |
| Monoisotopic Mass | 334.28718 |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C22H38O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24/h3-4,6-7,9-10H,2,5,8,11-21H2,1H3,(H,23,24)/b4-3-,7-6-,10-9- |
| InChIKey | WBBQTNCISCKUMU-PDBXOOCHSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (13Z,16Z,19Z)-docosatrienoic acid (CHEBI:77807) is a docosatrienoic acid (CHEBI:82846) |
| (13Z,16Z,19Z)-docosatrienoic acid (CHEBI:77807) is a ω−3 fatty acid (CHEBI:25681) |
| (13Z,16Z,19Z)-docosatrienoic acid (CHEBI:77807) is conjugate acid of (13Z,16Z,19Z)-docosatrienoate (CHEBI:77808) |
| Incoming Relation(s) |
| (13Z,16Z,19Z)-docosatrienoate (CHEBI:77808) is conjugate base of (13Z,16Z,19Z)-docosatrienoic acid (CHEBI:77807) |
| IUPAC Name |
|---|
| (13Z,16Z,19Z)-docosa-13,16,19-trienoic acid |
| Synonym | Source |
|---|---|
| all-cis-13,16,19 docosatrienoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0002823 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8165083 | Reaxys |
| CAS:28845-86-5 | HMDB |
| Citations |
|---|