EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H27N2 |
| Net Charge | +1 |
| Average Mass | 295.450 |
| Monoisotopic Mass | 295.21688 |
| SMILES | [H][C@@]12CCCc3c1n(c1ccc(C4CCCCC4)cc31)CC[NH2+]2 |
| InChI | InChI=1S/C20H26N2/c1-2-5-14(6-3-1)15-9-10-19-17(13-15)16-7-4-8-18-20(16)22(19)12-11-21-18/h9-10,13-14,18,21H,1-8,11-12H2/p+1/t18-/m1/s1 |
| InChIKey | AUXCHYJDVJZEPG-GOSISDBHSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-tetrindole(1+) (CHEBI:77793) is a ammonium ion derivative (CHEBI:35274) |
| (R)-tetrindole(1+) (CHEBI:77793) is a organic cation (CHEBI:25697) |
| (R)-tetrindole(1+) (CHEBI:77793) is conjugate acid of (R)-tetrindole (CHEBI:77814) |
| (R)-tetrindole(1+) (CHEBI:77793) is enantiomer of (S)-tetrindole(1+) (CHEBI:77797) |
| Incoming Relation(s) |
| (R)-tetrindole hydrochloride (CHEBI:77790) has part (R)-tetrindole(1+) (CHEBI:77793) |
| (R)-tetrindole mesylate (CHEBI:77782) has part (R)-tetrindole(1+) (CHEBI:77793) |
| (R)-tetrindole (CHEBI:77814) is conjugate base of (R)-tetrindole(1+) (CHEBI:77793) |
| (S)-tetrindole(1+) (CHEBI:77797) is enantiomer of (R)-tetrindole(1+) (CHEBI:77793) |
| IUPAC Name |
|---|
| (3aR)-8-cyclohexyl-2,3,3a,4,5,6-hexahydro-1H-pyrazino[3,2,1-jk]carbazol-3-ium |
| Synonym | Source |
|---|---|
| (R)-(−)-tetrindole(1+) | ChEBI |