EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26N2.CH4O3S |
| Net Charge | 0 |
| Average Mass | 390.549 |
| Monoisotopic Mass | 390.19771 |
| SMILES | CS(=O)(=O)O.[H][C@@]12CCCc3c1n(c1ccc(C4CCCCC4)cc31)CCN2 |
| InChI | InChI=1S/C20H26N2.CH4O3S/c1-2-5-14(6-3-1)15-9-10-19-17(13-15)16-7-4-8-18-20(16)22(19)12-11-21-18;1-5(2,3)4/h9-10,13-14,18,21H,1-8,11-12H2;1H3,(H,2,3,4)/t18-;/m1./s1 |
| InChIKey | CWPNPYVNPOAMHY-GMUIIQOCSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-tetrindole mesylate (CHEBI:77782) has part (R)-tetrindole(1+) (CHEBI:77793) |
| (R)-tetrindole mesylate (CHEBI:77782) is a methanesulfonate salt (CHEBI:38037) |
| (R)-tetrindole mesylate (CHEBI:77782) is enantiomer of (S)-tetrindole mesylate (CHEBI:77785) |
| Incoming Relation(s) |
| tetrindole mesylate (CHEBI:77779) has part (R)-tetrindole mesylate (CHEBI:77782) |
| (S)-tetrindole mesylate (CHEBI:77785) is enantiomer of (R)-tetrindole mesylate (CHEBI:77782) |
| IUPAC Names |
|---|
| (3aR)-8-cyclohexyl-2,3,3a,4,5,6-hexahydro-1H-pyrazino[3,2,1-jk]carbazol-3-ium methanesulfonate |
| (3aR)-8-cyclohexyl-2,3,3a,4,5,6-hexahydro-1H-pyrazino[3,2,1-jk]carbazole methanesulfonate |
| Synonyms | Source |
|---|---|
| (R)-(−)-tetrindole mesylate | ChEBI |
| (R)-(−)-tetrindole methanesulfonate | ChEBI |
| (R)-tetrindole methanesulfonate | ChEBI |