EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H38N2O4.HCl |
| Net Charge | 0 |
| Average Mass | 491.072 |
| Monoisotopic Mass | 490.25984 |
| SMILES | COc1ccc(CCN(C)CCC[C@](C#N)(c2ccc(OC)c(OC)c2)C(C)C)cc1OC.Cl |
| InChI | InChI=1S/C27H38N2O4.ClH/c1-20(2)27(19-28,22-10-12-24(31-5)26(18-22)33-7)14-8-15-29(3)16-13-21-9-11-23(30-4)25(17-21)32-6;/h9-12,17-18,20H,8,13-16H2,1-7H3;1H/t27-;/m1./s1 |
| InChIKey | DOQPXTMNIUCOSY-HZPIKELBSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 3.6.3.44 (xenobiotic-transporting ATPase) inhibitor An EC 3.6.3.* (acid anhydride hydrolase catalysing transmembrane movement of substances) inhibitor that interferes with the action of xenobiotic-transporting ATPase (EC 3.6.3.44). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dexverapamil hydrochloride (CHEBI:77739) has part dexverapamil(1+) (CHEBI:77737) |
| dexverapamil hydrochloride (CHEBI:77739) has role EC 3.6.3.44 (xenobiotic-transporting ATPase) inhibitor (CHEBI:77748) |
| dexverapamil hydrochloride (CHEBI:77739) is a hydrochloride (CHEBI:36807) |
| dexverapamil hydrochloride (CHEBI:77739) is enantiomer of (S)-verapamil hydrochloride (CHEBI:77741) |
| Incoming Relation(s) |
| verapamil hydrochloride (CHEBI:53188) has part dexverapamil hydrochloride (CHEBI:77739) |
| (S)-verapamil hydrochloride (CHEBI:77741) is enantiomer of dexverapamil hydrochloride (CHEBI:77739) |
| IUPAC Names |
|---|
| (2R)-2-(3,4-dimethoxyphenyl)-5-{[2-(3,4-dimethoxyphenyl)ethyl](methyl)amino}-2-isopropylpentanenitrile hydrochloride |
| (4R)-4-cyano-4-(3,4-dimethoxyphenyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]-N,5-dimethylhexan-1-aminium chloride |
| Synonyms | Source |
|---|---|
| dexverapamil HCl | ChEBI |
| dexverapamil.HCl | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6710895 | Reaxys |
| Citations |
|---|