EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H19O10 |
| Net Charge | -1 |
| Average Mass | 431.373 |
| Monoisotopic Mass | 431.09837 |
| SMILES | O=c1cc(-c2ccc(O)cc2)oc2cc(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)cc([O-])c12 |
| InChI | InChI=1S/C21H20O10/c22-8-16-18(26)19(27)20(28)21(31-16)29-11-5-12(24)17-13(25)7-14(30-15(17)6-11)9-1-3-10(23)4-2-9/h1-7,16,18-24,26-28H,8H2/p-1/t16-,18-,19+,20-,21-/m1/s1 |
| InChIKey | KMOUJOKENFFTPU-QNDFHXLGSA-M |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Application: | non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| apigenin 7-O-β-D-glucoside(1−) (CHEBI:77722) has role antibacterial agent (CHEBI:33282) |
| apigenin 7-O-β-D-glucoside(1−) (CHEBI:77722) has role metabolite (CHEBI:25212) |
| apigenin 7-O-β-D-glucoside(1−) (CHEBI:77722) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| apigenin 7-O-β-D-glucoside(1−) (CHEBI:77722) is a flavonoid oxoanion (CHEBI:60038) |
| apigenin 7-O-β-D-glucoside(1−) (CHEBI:77722) is conjugate base of apigenin 7-O-β-D-glucoside (CHEBI:16778) |
| Incoming Relation(s) |
| apigenin 7-O-β-D-glucoside (CHEBI:16778) is conjugate acid of apigenin 7-O-β-D-glucoside(1−) (CHEBI:77722) |
| IUPAC Name |
|---|
| 7-(β-D-glucopyranosyloxy)-2-(4-hydroxyphenyl)-4-oxo-4H-chromen-5-olate |
| UniProt Name | Source |
|---|---|
| apigenin 7-O-β-D-glucoside | UniProt |