EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20O10 |
| Net Charge | 0 |
| Average Mass | 432.381 |
| Monoisotopic Mass | 432.10565 |
| SMILES | O=c1cc(-c2ccc(O)cc2)oc2cc(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)cc(O)c12 |
| InChI | InChI=1S/C21H20O10/c22-8-16-18(26)19(27)20(28)21(31-16)29-11-5-12(24)17-13(25)7-14(30-15(17)6-11)9-1-3-10(23)4-2-9/h1-7,16,18-24,26-28H,8H2/t16-,18-,19+,20-,21-/m1/s1 |
| InChIKey | KMOUJOKENFFTPU-QNDFHXLGSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Application: | non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| apigenin 7-O-β-D-glucoside (CHEBI:16778) has functional parent apigenin (CHEBI:18388) |
| apigenin 7-O-β-D-glucoside (CHEBI:16778) has role antibacterial agent (CHEBI:33282) |
| apigenin 7-O-β-D-glucoside (CHEBI:16778) has role metabolite (CHEBI:25212) |
| apigenin 7-O-β-D-glucoside (CHEBI:16778) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| apigenin 7-O-β-D-glucoside (CHEBI:16778) is a dihydroxyflavone (CHEBI:38686) |
| apigenin 7-O-β-D-glucoside (CHEBI:16778) is a glycosyloxyflavone (CHEBI:50018) |
| apigenin 7-O-β-D-glucoside (CHEBI:16778) is a monosaccharide derivative (CHEBI:63367) |
| apigenin 7-O-β-D-glucoside (CHEBI:16778) is a β-D-glucoside (CHEBI:22798) |
| apigenin 7-O-β-D-glucoside (CHEBI:16778) is conjugate acid of apigenin 7-O-β-D-glucoside(1−) (CHEBI:77722) |
| apigenin 7-O-β-D-glucoside (CHEBI:16778) is enantiomer of apigenin 7-O-β-L-glucoside (CHEBI:132818) |
| Incoming Relation(s) |
| apigenin 7-O-β-D-glucoside(1−) (CHEBI:77722) is conjugate base of apigenin 7-O-β-D-glucoside (CHEBI:16778) |
| apigenin 7-O-β-L-glucoside (CHEBI:132818) is enantiomer of apigenin 7-O-β-D-glucoside (CHEBI:16778) |
| IUPAC Name |
|---|
| 5-hydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-chromen-7-yl β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| 5-hydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-chromen-7-yl β-D-glucopyranoside | ChEBI |
| 7-(beta-D-Glucopyranosyloxy)-5-hydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one | KEGG COMPOUND |
| 7-O-beta-D-Glucosyl-5,7,4'-trihydroxyflavone | KEGG COMPOUND |
| 7-O-beta-D-Glucosyl-5,7,4'-trihydroxyflavone | KEGG COMPOUND |
| apigenin 7-O-beta-D-glucoside | ChemIDplus |
| Apigenin 7-O-glucoside | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| APIGENIN-7-O-BETA-D-GLUCOSIDE | MetaCyc |
| Apigetrin | Wikipedia |
| C00001017 | KNApSAcK |
| C04608 | KEGG COMPOUND |
| HMDB0037340 | HMDB |
| LSM-2286 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:65669 | Reaxys |
| CAS:578-74-5 | KEGG COMPOUND |
| CAS:578-74-5 | ChemIDplus |
| Citations |
|---|