EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H9O5 |
| Net Charge | -1 |
| Average Mass | 269.232 |
| Monoisotopic Mass | 269.04555 |
| SMILES | Cc1cc(O)c2c(c1)C(=O)c1cc([O-])cc(O)c1C2=O |
| InChI | InChI=1S/C15H10O5/c1-6-2-8-12(10(17)3-6)15(20)13-9(14(8)19)4-7(16)5-11(13)18/h2-5,16-18H,1H3/p-1 |
| InChIKey | RHMXXJGYXNZAPX-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Roles: | tyrosine kinase inhibitor Any protein kinase inhibitor that interferes with the action of tyrosine kinase. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. laxative An agent that produces a soft formed stool, and relaxes and loosens the bowels, typically used over a protracted period, to relieve constipation. Compare with cathartic, which is a substance that accelerates defecation. A substances can be both a laxative and a cathartic. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| emodin(1−) (CHEBI:77659) has role antineoplastic agent (CHEBI:35610) |
| emodin(1−) (CHEBI:77659) has role laxative (CHEBI:50503) |
| emodin(1−) (CHEBI:77659) has role plant metabolite (CHEBI:76924) |
| emodin(1−) (CHEBI:77659) has role tyrosine kinase inhibitor (CHEBI:38637) |
| emodin(1−) (CHEBI:77659) is a phenolate anion (CHEBI:50525) |
| emodin(1−) (CHEBI:77659) is conjugate base of emodin (CHEBI:42223) |
| Incoming Relation(s) |
| emodin (CHEBI:42223) is conjugate acid of emodin(1−) (CHEBI:77659) |
| IUPAC Name |
|---|
| 4,5-dihydroxy-7-methyl-9,10-dioxo-9,10-dihydroanthracen-2-olate |
| UniProt Name | Source |
|---|---|
| emodin | UniProt |