EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H22O3 |
| Net Charge | 0 |
| Average Mass | 310.393 |
| Monoisotopic Mass | 310.15689 |
| SMILES | [H][C@@]1(c2ccc(OC(C)(C)C(=O)O)cc2)CCCc2ccccc21 |
| InChI | InChI=1S/C20H22O3/c1-20(2,19(21)22)23-16-12-10-15(11-13-16)18-9-5-7-14-6-3-4-8-17(14)18/h3-4,6,8,10-13,18H,5,7,9H2,1-2H3,(H,21,22)/t18-/m0/s1 |
| InChIKey | XJGBDJOMWKAZJS-SFHVURJKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-nafenopin (CHEBI:77651) is a 2-methyl-2-[4-(1,2,3,4-tetrahydronaphthalen-1-yl)phenoxy]propanoic acid (CHEBI:77649) |
| (S)-nafenopin (CHEBI:77651) is enantiomer of (R)-nafenopin (CHEBI:77650) |
| Incoming Relation(s) |
| nafenopin (CHEBI:7449) has part (S)-nafenopin (CHEBI:77651) |
| (R)-nafenopin (CHEBI:77650) is enantiomer of (S)-nafenopin (CHEBI:77651) |
| IUPAC Name |
|---|
| 2-methyl-2-{4-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]phenoxy}propanoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7283462 | Reaxys |