EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H7O3 |
| Net Charge | -1 |
| Average Mass | 127.119 |
| Monoisotopic Mass | 127.04007 |
| SMILES | O=C1C=C([O-])CC(O)C1 |
| InChI | InChI=1S/C6H8O3/c7-4-1-5(8)3-6(9)2-4/h1,6-7,9H,2-3H2/p-1 |
| InChIKey | JUOPGIRJUCFNBD-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dihydrophloroglucinol(1−) (CHEBI:77638) is a organic anion (CHEBI:25696) |
| dihydrophloroglucinol(1−) (CHEBI:77638) is conjugate base of dihydrophloroglucinol (CHEBI:16370) |
| Incoming Relation(s) |
| dihydrophloroglucinol (CHEBI:16370) is conjugate acid of dihydrophloroglucinol(1−) (CHEBI:77638) |
| IUPAC Name |
|---|
| 5-hydroxy-3-oxocyclohex-1-en-1-olate |
| UniProt Name | Source |
|---|---|
| dihydrophloroglucinol | UniProt |