EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:16370 - dihydrophloroglucinol
| Formula | C6H8O3 |
| Net Charge | 0 |
| Average Mass | 128.127 |
| Monoisotopic Mass | 128.04734 |
| SMILES | O=C1C=C(O)CC(O)C1 |
| InChI | InChI=1S/C6H8O3/c7-4-1-5(8)3-6(9)2-4/h1,6-7,9H,2-3H2 |
| InChIKey | JUOPGIRJUCFNBD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | electron donor A molecular entity that can transfer an electron to another molecular entity. electron donor A molecular entity that can transfer an electron to another molecular entity. |
| Biological Role: | algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dihydrophloroglucinol (CHEBI:16370) is a phloroglucinol (CHEBI:16204) |
| dihydrophloroglucinol (CHEBI:16370) is conjugate acid of dihydrophloroglucinol(1−) (CHEBI:77638) |
| Incoming Relation(s) |
| dihydrophloroglucinol(1−) (CHEBI:77638) is conjugate base of dihydrophloroglucinol (CHEBI:16370) |
| IUPAC Name |
|---|
| 3,5-dihydroxycyclohex-2-en-1-one |
| Synonym | Source |
|---|---|
| Dihydrophloroglucinol | KEGG COMPOUND |