EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H25N2O2 |
| Net Charge | +1 |
| Average Mass | 313.421 |
| Monoisotopic Mass | 313.19105 |
| SMILES | [H][C@@]12C3C[C@]4(c5ccccc5N[C@@]4([H])[C@]4([H])C[C@H]1[C@H](CC)[C@@H](O)[NH+]34)[C@@H]2O |
| InChI | InChI=1S/C19H24N2O2/c1-2-9-10-7-13-16-19(11-5-3-4-6-12(11)20-16)8-14(15(10)17(19)22)21(13)18(9)23/h3-6,9-10,13-18,20,22-23H,2,7-8H2,1H3/p+1/t9-,10-,13-,14?,15-,16-,17+,18+,19+/m0/s1 |
| InChIKey | HIOAYNMZFIHQNS-WGSNPMNHSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| norajmaline(1+) (CHEBI:77618) is a ammonium ion derivative (CHEBI:35274) |
| norajmaline(1+) (CHEBI:77618) is a organic cation (CHEBI:25697) |
| norajmaline(1+) (CHEBI:77618) is conjugate acid of norajmaline (CHEBI:7621) |
| Incoming Relation(s) |
| norajmaline (CHEBI:7621) is conjugate base of norajmaline(1+) (CHEBI:77618) |
| IUPAC Name |
|---|
| (2β,7β,17R,20β,21α)-17,21-dihydroxy-2,7,19,20-tetrahydro-7,17-cyclosarpagan-4-ium |
| UniProt Name | Source |
|---|---|
| norajmaline | UniProt |