EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:7621 - norajmaline
| Formula | C19H24N2O2 |
| Net Charge | 0 |
| Average Mass | 312.413 |
| Monoisotopic Mass | 312.18378 |
| SMILES | [H][C@@]12[C@@H]3C[C@]4(c5ccccc5N[C@@]4([H])[C@]4([H])C[C@H]1[C@H](CC)[C@@H](O)N34)[C@@H]2O |
| InChI | InChI=1S/C19H24N2O2/c1-2-9-10-7-13-16-19(11-5-3-4-6-12(11)20-16)8-14(15(10)17(19)22)21(13)18(9)23/h3-6,9-10,13-18,20,22-23H,2,7-8H2,1H3/t9-,10-,13-,14-,15-,16-,17+,18+,19+/m0/s1 |
| InChIKey | HIOAYNMZFIHQNS-DEKAJGEMSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| norajmaline (CHEBI:7621) has functional parent ajmaline (CHEBI:28462) |
| norajmaline (CHEBI:7621) is a bridged compound (CHEBI:35990) |
| norajmaline (CHEBI:7621) is a hemiaminal (CHEBI:73080) |
| norajmaline (CHEBI:7621) is a indole alkaloid (CHEBI:38958) |
| norajmaline (CHEBI:7621) is a organonitrogen heterocyclic compound (CHEBI:38101) |
| norajmaline (CHEBI:7621) is a secondary alcohol (CHEBI:35681) |
| norajmaline (CHEBI:7621) is a secondary amino compound (CHEBI:50995) |
| norajmaline (CHEBI:7621) is a tertiary amino compound (CHEBI:50996) |
| norajmaline (CHEBI:7621) is conjugate base of norajmaline(1+) (CHEBI:77618) |
| Incoming Relation(s) |
| 17-O-acetylnorajmaline (CHEBI:17384) has functional parent norajmaline (CHEBI:7621) |
| norajmaline(1+) (CHEBI:77618) is conjugate acid of norajmaline (CHEBI:7621) |
| IUPAC Name |
|---|
| 22-norajmalan-17α,21α-diol |
| Synonym | Source |
|---|---|
| Norajmaline | KEGG COMPOUND |
| Citations |
|---|