EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H15F3N4O3.C7H8O3S |
| Net Charge | 0 |
| Average Mass | 576.553 |
| Monoisotopic Mass | 576.12904 |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.NC1CCN(c2nc3c(cc2F)c(=O)c(C(=O)O)cn3-c2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C19H15F3N4O3.C7H8O3S/c20-9-1-2-15(13(21)5-9)26-8-12(19(28)29)16(27)11-6-14(22)18(24-17(11)26)25-4-3-10(23)7-25;1-6-2-4-7(5-3-6)11(8,9)10/h1-2,5-6,8,10H,3-4,7,23H2,(H,28,29);2-5H,1H3,(H,8,9,10) |
| InChIKey | CSSQVOKOWWIUCX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. DNA synthesis inhibitor Any substance that inhibits the synthesis of DNA. hepatotoxic agent A role played by a chemical compound exhibiting itself through the ability to induce damage to the liver in animals. topoisomerase IV inhibitor A topoisomerase inhibitor that inhibits DNA topoisomerase IV, which catalyses ATP-dependent breakage of both strands of DNA, passage of the unbroken strands through the breaks, and rejoining of the broken strands. |
| Application: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tosufloxacin tosylate (CHEBI:77605) has part (R)-tosufloxacin tosylate (CHEBI:77607) |
| tosufloxacin tosylate (CHEBI:77605) has part (S)-tosufloxacin tosylate (CHEBI:77606) |
| tosufloxacin tosylate (CHEBI:77605) has part tosufloxacin(1+) (CHEBI:77586) |
| tosufloxacin tosylate (CHEBI:77605) has role antiinfective agent (CHEBI:35441) |
| tosufloxacin tosylate (CHEBI:77605) has role antimicrobial agent (CHEBI:33281) |
| tosufloxacin tosylate (CHEBI:77605) has role DNA synthesis inhibitor (CHEBI:59517) |
| tosufloxacin tosylate (CHEBI:77605) has role hepatotoxic agent (CHEBI:50908) |
| tosufloxacin tosylate (CHEBI:77605) has role topoisomerase IV inhibitor (CHEBI:53559) |
| tosufloxacin tosylate (CHEBI:77605) is a racemate (CHEBI:60911) |
| Incoming Relation(s) |
| tosufloxacin tosylate hydrate (CHEBI:32248) has part tosufloxacin tosylate (CHEBI:77605) |
| IUPAC Names |
|---|
| rac-1-[6-carboxy-8-(2,4-difluorophenyl)-3-fluoro-5-oxo-5,8-dihydro-1,8-naphthyridin-2-yl]pyrrolidin-3-aminium 4-methylbenzenesulfonate |
| rac-7-(3-aminopyrrolidin-1-yl)-1-(2,4-difluorophenyl)-6-fluoro-4-oxo-1,4-dihydro-1,8-naphthyridine-3-carboxylic acid 4-methylbenzenesulfonate |
| Synonyms | Source |
|---|---|
| A 61827 | ChemIDplus |
| A-61827 | ChemIDplus |
| rac-tosufloxacin tosylate | ChEBI |
| (RS)-tosufloxacin tosylate | ChEBI |
| racemic tosufloxacin tosylate | ChEBI |
| tosufloxacin monotosylate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7617816 | Reaxys |
| CAS:100490-94-6 | ChemIDplus |
| CAS:115964-29-9 | ChemIDplus |