EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H15F3N4O3.C7H8O3S.H2O |
| Net Charge | 0 |
| Average Mass | 594.568 |
| Monoisotopic Mass | 594.13960 |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.NC1CCN(c2nc3c(cc2F)c(=O)c(C(=O)O)cn3-c2ccc(F)cc2F)C1.O |
| InChI | InChI=1S/C19H15F3N4O3.C7H8O3S.H2O/c20-9-1-2-15(13(21)5-9)26-8-12(19(28)29)16(27)11-6-14(22)18(24-17(11)26)25-4-3-10(23)7-25;1-6-2-4-7(5-3-6)11(8,9)10;/h1-2,5-6,8,10H,3-4,7,23H2,(H,28,29);2-5H,1H3,(H,8,9,10);1H2 |
| InChIKey | SSULTCPIIYRGFQ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. topoisomerase IV inhibitor A topoisomerase inhibitor that inhibits DNA topoisomerase IV, which catalyses ATP-dependent breakage of both strands of DNA, passage of the unbroken strands through the breaks, and rejoining of the broken strands. DNA synthesis inhibitor Any substance that inhibits the synthesis of DNA. hepatotoxic agent A role played by a chemical compound exhibiting itself through the ability to induce damage to the liver in animals. |
| Application: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tosufloxacin tosylate hydrate (CHEBI:32248) has part (R)-tosufloxacin tosylate hydrate (CHEBI:77604) |
| tosufloxacin tosylate hydrate (CHEBI:32248) has part (S)-tosufloxacin tosylate hydrate (CHEBI:77599) |
| tosufloxacin tosylate hydrate (CHEBI:32248) has part tosufloxacin tosylate (CHEBI:77605) |
| tosufloxacin tosylate hydrate (CHEBI:32248) has role antiinfective agent (CHEBI:35441) |
| tosufloxacin tosylate hydrate (CHEBI:32248) has role antimicrobial agent (CHEBI:33281) |
| tosufloxacin tosylate hydrate (CHEBI:32248) has role DNA synthesis inhibitor (CHEBI:59517) |
| tosufloxacin tosylate hydrate (CHEBI:32248) has role hepatotoxic agent (CHEBI:50908) |
| tosufloxacin tosylate hydrate (CHEBI:32248) has role topoisomerase IV inhibitor (CHEBI:53559) |
| tosufloxacin tosylate hydrate (CHEBI:32248) is a racemate (CHEBI:60911) |
| IUPAC Names |
|---|
| rac-1-[6-carboxy-8-(2,4-difluorophenyl)-3-fluoro-5-oxo-5,8-dihydro-1,8-naphthyridin-2-yl]pyrrolidin-3-aminium 4-methylbenzenesulfonate—water (1/1) |
| rac-7-(3-aminopyrrolidin-1-yl)-1-(2,4-difluorophenyl)-6-fluoro-4-oxo-1,4-dihydro-1,8-naphthyridine-3-carboxylic acid 4-methylbenzenesulfonate—water (1/1) |
| Synonyms | Source |
|---|---|
| rac-tosufloxacin tosylate hydrate | ChEBI |
| (RS)-tosufloxacin tosylate hydrate | ChEBI |
| racemic tosufloxacin tosylate hydrate | ChEBI |
| tosufloxacin monotosylate monohydrate | ChEBI |
| (±)-tosufloxacin tosylate hydrate | ChEBI |
| Tosufloxacin tosylate monohydrate | ChemIDplus |
| Brand Name | Source |
|---|---|
| Ozex | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D01996 | KEGG DRUG |
| Tosufloxacin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:1400591-39-0 | ChemIDplus |