EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H15NO2S |
| Net Charge | 0 |
| Average Mass | 273.357 |
| Monoisotopic Mass | 273.08235 |
| SMILES | NC(=O)C[S@@](=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H15NO2S/c16-14(17)11-19(18)15(12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10,15H,11H2,(H2,16,17)/t19-/m1/s1 |
| InChIKey | YFGHCGITMMYXAQ-LJQANCHMSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. eugeroic A phsychotropic drug that improves wakefulness and alertness, and reduces tiredness, drowsiness, and the need for sleep. Eugeroics are relatively non-addictive and are used in the treatment of narcolepsy and other sleep disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| armodafinil (CHEBI:77590) has role central nervous system stimulant (CHEBI:35337) |
| armodafinil (CHEBI:77590) has role eugeroic (CHEBI:77567) |
| armodafinil (CHEBI:77590) is a 2-[(diphenylmethyl)sulfinyl]acetamide (CHEBI:77585) |
| armodafinil (CHEBI:77590) is enantiomer of (S)-modafinil (CHEBI:77591) |
| Incoming Relation(s) |
| modafinil (CHEBI:31859) has part armodafinil (CHEBI:77590) |
| (S)-modafinil (CHEBI:77591) is enantiomer of armodafinil (CHEBI:77590) |
| IUPAC Name |
|---|
| 2-[(R)-(diphenylmethyl)sulfinyl]acetamide |
| INNs | Source |
|---|---|
| armodafinil | WHO MedNet |
| armodafinil | WHO MedNet |
| armodafinilo | WHO MedNet |
| armodafinilum | WHO MedNet |
| Synonyms | Source |
|---|---|
| CEP 10953 | ChemIDplus |
| CEP-10953 | ChemIDplus |
| (R)-(−)-modafinil | ChEBI |
| (R)-modafinil | ChEBI |
| (−)-(R)-modafinil | ChEBI |
| (−)-modafinil | ChEBI |
| Brand Name | Source |
|---|---|
| Nuvigil | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 4501 | DrugCentral |
| Armodafinil | Wikipedia |
| D03215 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9767970 | Reaxys |
| CAS:112111-43-0 | ChemIDplus |
| CAS:112111-43-0 | KEGG DRUG |
| Citations |
|---|