EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H12N2O3 |
| Net Charge | 0 |
| Average Mass | 148.162 |
| Monoisotopic Mass | 148.08479 |
| SMILES | NCC[C@H](O)[C@H](N)C(=O)O |
| InChI | InChI=1S/C5H12N2O3/c6-2-1-3(8)4(7)5(9)10/h3-4,8H,1-2,6-7H2,(H,9,10)/t3-,4-/m0/s1 |
| InChIKey | UHPDQDWXMXBLRX-IMJSIDKUSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3S)-3-hydroxy-L-ornithine (CHEBI:77488) is a L-ornithine derivative (CHEBI:21368) |
| (3S)-3-hydroxy-L-ornithine (CHEBI:77488) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| (3S)-3-hydroxy-L-ornithine (CHEBI:77488) is conjugate base of (3S)-3-hydroxy-L-ornithine(1+) (CHEBI:77411) |
| Incoming Relation(s) |
| (3S)-3-hydroxy-L-ornithine(1+) (CHEBI:77411) is conjugate acid of (3S)-3-hydroxy-L-ornithine (CHEBI:77488) |
| IUPAC Name |
|---|
| (3S)-3-hydroxy-L-ornithine |
| Synonyms | Source |
|---|---|
| (3S)-3-hydroxyornithine | ChEBI |
| L-erythro-β-hydroxyornithine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5244928 | Reaxys |