EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H13N2O3 |
| Net Charge | +1 |
| Average Mass | 149.170 |
| Monoisotopic Mass | 149.09207 |
| SMILES | [NH3+]CC[C@H](O)[C@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C5H12N2O3/c6-2-1-3(8)4(7)5(9)10/h3-4,8H,1-2,6-7H2,(H,9,10)/p+1/t3-,4-/m0/s1 |
| InChIKey | UHPDQDWXMXBLRX-IMJSIDKUSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3S)-3-hydroxy-L-ornithine(1+) (CHEBI:77411) is a α-amino-acid cation (CHEBI:33719) |
| (3S)-3-hydroxy-L-ornithine(1+) (CHEBI:77411) is conjugate acid of (3S)-3-hydroxy-L-ornithine (CHEBI:77488) |
| Incoming Relation(s) |
| (3S)-3-hydroxy-L-ornithine (CHEBI:77488) is conjugate base of (3S)-3-hydroxy-L-ornithine(1+) (CHEBI:77411) |
| IUPAC Name |
|---|
| 2,5-diazaniumyl-2,4,5-trideoxy-L-erythro-pentonate |
| Synonyms | Source |
|---|---|
| (2S,3S)-2,5-diamino-3-hydroxypentanoic acid(1+) | SUBMITTER |
| 2,5-diammonio-2,4,5-trideoxy-L-erythro-pentonate | IUPAC |
| UniProt Name | Source |
|---|---|
| (3S)-3-hydroxy-L-ornithine | UniProt |