EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H29N2O |
| Net Charge | +1 |
| Average Mass | 289.443 |
| Monoisotopic Mass | 289.22744 |
| SMILES | CCCC[NH+]1CCCCC1C(=O)Nc1c(C)cccc1C |
| InChI | InChI=1S/C18H28N2O/c1-4-5-12-20-13-7-6-11-16(20)18(21)19-17-14(2)9-8-10-15(17)3/h8-10,16H,4-7,11-13H2,1-3H3,(H,19,21)/p+1 |
| InChIKey | LEBVLXFERQHONN-UHFFFAOYSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bupivacaine(1+) (CHEBI:77455) has part dextrobupivacaine(1+) (CHEBI:77459) |
| bupivacaine(1+) (CHEBI:77455) has part levobupivacaine(1+) (CHEBI:77458) |
| bupivacaine(1+) (CHEBI:77455) is a racemate (CHEBI:60911) |
| bupivacaine(1+) (CHEBI:77455) is conjugate acid of bupivacaine (CHEBI:3215) |
| Incoming Relation(s) |
| bupivacaine hydrochloride (anhydrous) (CHEBI:31322) has part bupivacaine(1+) (CHEBI:77455) |
| bupivacaine (CHEBI:3215) is conjugate base of bupivacaine(1+) (CHEBI:77455) |
| IUPAC Name |
|---|
| rac-1-butyl-2-[(2,6-dimethylphenyl)carbamoyl]piperidinium |
| Synonym | Source |
|---|---|
| bupivacaine cation | ChEBI |