EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H50O2 |
| Net Charge | 0 |
| Average Mass | 442.728 |
| Monoisotopic Mass | 442.38108 |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C30H50O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27-28-29-30(31)32/h3-4,6-7,9-10,12-13,15-16H,2,5,8,11,14,17-29H2,1H3,(H,31,32)/b4-3-,7-6-,10-9-,13-12-,16-15- |
| InChIKey | WGXVWUXXHNEMLO-JLNKQSITSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (15Z,18Z,21Z,24Z,27Z)-triacontapentaenoic acid (CHEBI:77375) is a triacontapentaenoic acid (CHEBI:78912) |
| (15Z,18Z,21Z,24Z,27Z)-triacontapentaenoic acid (CHEBI:77375) is a ω−3 fatty acid (CHEBI:25681) |
| (15Z,18Z,21Z,24Z,27Z)-triacontapentaenoic acid (CHEBI:77375) is conjugate acid of (15Z,18Z,21Z,24Z,27Z)-triacontapentaenoate (CHEBI:77210) |
| Incoming Relation(s) |
| (15Z,18Z,21Z,24Z,27Z)-triacontapentaenoate (CHEBI:77210) is conjugate base of (15Z,18Z,21Z,24Z,27Z)-triacontapentaenoic acid (CHEBI:77375) |
| IUPAC Name |
|---|
| (15Z,18Z,21Z,24Z,27Z)-triaconta-15,18,21,24,27-pentaenoic acid |
| Synonyms | Source |
|---|---|
| 15Z,18Z,21Z,24Z,27Z-triacontapentaenoic acid | LIPID MAPS |
| 30:5(15Z,18Z,21Z,24Z,27Z) | LIPID MAPS |
| 30:5n3 | LIPID MAPS |
| 30:5(ω3) | LIPID MAPS |
| all-cis-triaconta-15,18,21,24,27-pentaenoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01030833 | LIPID MAPS |