EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H44O2 |
| Net Charge | 0 |
| Average Mass | 412.658 |
| Monoisotopic Mass | 412.33413 |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCCCCCC(=O)O |
| InChI | InChI=1S/C28H44O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27-28(29)30/h3-4,6-7,9-10,12-13,15-16,18-19H,2,5,8,11,14,17,20-27H2,1H3,(H,29,30)/b4-3-,7-6-,10-9-,13-12-,16-15-,19-18- |
| InChIKey | BQXYAHWVQOZPTF-KUBAVDMBSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (10Z,13Z,16Z,19Z,22Z,25Z)-octacosahexaenoic acid (CHEBI:77373) is a octacosahexaenoic acid (CHEBI:78906) |
| (10Z,13Z,16Z,19Z,22Z,25Z)-octacosahexaenoic acid (CHEBI:77373) is a ω−3 fatty acid (CHEBI:25681) |
| (10Z,13Z,16Z,19Z,22Z,25Z)-octacosahexaenoic acid (CHEBI:77373) is conjugate acid of (10Z,13Z,16Z,19Z,22Z,25Z)-octacosahexaenoate (CHEBI:77209) |
| Incoming Relation(s) |
| (10Z,13Z,16Z,19Z,22Z,25Z)-octacosahexaenoate (CHEBI:77209) is conjugate base of (10Z,13Z,16Z,19Z,22Z,25Z)-octacosahexaenoic acid (CHEBI:77373) |
| IUPAC Name |
|---|
| (10Z,13Z,16Z,19Z,22Z,25Z)-octacosa-10,13,16,19,22,25-hexaenoic acid |
| Synonyms | Source |
|---|---|
| all-cis-octacosa-10,13,16,19,22,25-hexaenoic acid | ChEBI |
| 28:6(10Z,13Z,16Z,19Z,22Z,25Z) | LIPID MAPS |
| 28:6(ω3) | LIPID MAPS |
| 28:6n3 | LIPID MAPS |
| 10Z,13Z,16Z,19Z,22Z,25Z-octacosahexaenoic acid | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMFA01030839 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21380641 | Reaxys |