EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:77371 - (8Z,11Z,14Z,17Z,20Z,23Z)-hexacosahexaenoic acid
| Formula | C26H40O2 |
| Net Charge | 0 |
| Average Mass | 384.604 |
| Monoisotopic Mass | 384.30283 |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCCCC(=O)O |
| InChI | InChI=1S/C26H40O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26(27)28/h3-4,6-7,9-10,12-13,15-16,18-19H,2,5,8,11,14,17,20-25H2,1H3,(H,27,28)/b4-3-,7-6-,10-9-,13-12-,16-15-,19-18- |
| InChIKey | GLEIIPZRQAMQLG-KUBAVDMBSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (8Z,11Z,14Z,17Z,20Z,23Z)-hexacosahexaenoic acid (CHEBI:77371) is a hexacosahexaenoic acid (CHEBI:78866) |
| (8Z,11Z,14Z,17Z,20Z,23Z)-hexacosahexaenoic acid (CHEBI:77371) is a ω−3 fatty acid (CHEBI:25681) |
| (8Z,11Z,14Z,17Z,20Z,23Z)-hexacosahexaenoic acid (CHEBI:77371) is conjugate acid of (8Z,11Z,14Z,17Z,20Z,23Z)-hexacosahexaenoate (CHEBI:77205) |
| Incoming Relation(s) |
| (8Z,11Z,14Z,17Z,20Z,23Z)-hexacosahexaenoyl-CoA (CHEBI:74587) has functional parent (8Z,11Z,14Z,17Z,20Z,23Z)-hexacosahexaenoic acid (CHEBI:77371) |
| (8Z,11Z,14Z,17Z,20Z,23Z)-hexacosahexaenoate (CHEBI:77205) is conjugate base of (8Z,11Z,14Z,17Z,20Z,23Z)-hexacosahexaenoic acid (CHEBI:77371) |
| IUPAC Name |
|---|
| (8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-8,11,14,17,20,23-hexaenoic acid |
| Synonyms | Source |
|---|---|
| all-cis-hexacosa-8,11,14,17,20,23-hexaenoic acid | ChEBI |
| 8Z,11Z,14Z,17Z,20Z,23Z-hexacosahexaenoic acid | LIPID MAPS |
| 26:6(8Z,11Z,14Z,17Z,20Z,23Z) | LIPID MAPS |
| 26:6(ω3) | LIPID MAPS |
| 26:6n3 | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMFA01030838 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22804666 | Reaxys |