EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H36O2 |
| Net Charge | 0 |
| Average Mass | 356.550 |
| Monoisotopic Mass | 356.27153 |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCC(=O)O |
| InChI | InChI=1S/C24H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24(25)26/h3-4,6-7,9-10,12-13,15-16,18-19H,2,5,8,11,14,17,20-23H2,1H3,(H,25,26)/b4-3-,7-6-,10-9-,13-12-,16-15-,19-18- |
| InChIKey | YHGJECVSSKXFCJ-KUBAVDMBSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (6Z,9Z,12Z,15Z,18Z,21Z)-tetracosahexaenoic acid (CHEBI:77366) is a tetracosahexaenoic acid (CHEBI:72714) |
| (6Z,9Z,12Z,15Z,18Z,21Z)-tetracosahexaenoic acid (CHEBI:77366) is a ω−3 fatty acid (CHEBI:25681) |
| (6Z,9Z,12Z,15Z,18Z,21Z)-tetracosahexaenoic acid (CHEBI:77366) is conjugate acid of (6Z,9Z,12Z,15Z,18Z,21Z)-tetracosahexaenoate (CHEBI:77202) |
| Incoming Relation(s) |
| (6Z,9Z,12Z,15Z,18Z,21Z)-tetracosahexaenoyl-CoA (CHEBI:63540) has functional parent (6Z,9Z,12Z,15Z,18Z,21Z)-tetracosahexaenoic acid (CHEBI:77366) |
| (6Z,9Z,12Z,15Z,18Z,21Z)-tetracosahexaenoate (CHEBI:77202) is conjugate base of (6Z,9Z,12Z,15Z,18Z,21Z)-tetracosahexaenoic acid (CHEBI:77366) |
| IUPAC Name |
|---|
| (6Z,9Z,12Z,15Z,18Z,21Z)-tetracosa-6,9,12,15,18,21-hexaenoic acid |
| Synonyms | Source |
|---|---|
| 6Z,9Z,12Z,15Z,18Z,21Z-tetracosahexaenoic acid | LIPID MAPS |
| All-cis-6,9,12,15,18,21-tetracosahexaenoic acid | HMDB |
| C24:6n-3 | LIPID MAPS |
| C24:6ω-3 | ChEBI |
| all-cis-tetracosa-6,9,12,15,18,21-hexaenoic acid | ChEBI |
| Nisinic acid | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| HMDB0013025 | HMDB |
| LMFA01030822 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7539663 | Reaxys |
| Citations |
|---|