EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H36O2 |
| Net Charge | 0 |
| Average Mass | 356.550 |
| Monoisotopic Mass | 356.27153 |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCC(=O)O |
| InChI | InChI=1S/C24H36O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24(25)26/h3-4,6-7,9-10,12-13,15-16,18-19H,2,5,8,11,14,17,20-23H2,1H3,(H,25,26)/b4-3-,7-6-,10-9-,13-12-,16-15-,19-18- |
| InChIKey | YHGJECVSSKXFCJ-KUBAVDMBSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (6Z,9Z,12Z,15Z,18Z,21Z)-tetracosahexaenoic acid (CHEBI:77366) is a tetracosahexaenoic acid (CHEBI:72714) |
| (6Z,9Z,12Z,15Z,18Z,21Z)-tetracosahexaenoic acid (CHEBI:77366) is a ω−3 fatty acid (CHEBI:25681) |
| (6Z,9Z,12Z,15Z,18Z,21Z)-tetracosahexaenoic acid (CHEBI:77366) is conjugate acid of (6Z,9Z,12Z,15Z,18Z,21Z)-tetracosahexaenoate (CHEBI:77202) |
| Incoming Relation(s) |
| (6Z,9Z,12Z,15Z,18Z,21Z)-tetracosahexaenoyl-CoA (CHEBI:63540) has functional parent (6Z,9Z,12Z,15Z,18Z,21Z)-tetracosahexaenoic acid (CHEBI:77366) |
| (6Z,9Z,12Z,15Z,18Z,21Z)-tetracosahexaenoate (CHEBI:77202) is conjugate base of (6Z,9Z,12Z,15Z,18Z,21Z)-tetracosahexaenoic acid (CHEBI:77366) |
| IUPAC Name |
|---|
| (6Z,9Z,12Z,15Z,18Z,21Z)-tetracosa-6,9,12,15,18,21-hexaenoic acid |
| Synonyms | Source |
|---|---|
| 6Z,9Z,12Z,15Z,18Z,21Z-tetracosahexaenoic acid | LIPID MAPS |
| All-cis-6,9,12,15,18,21-tetracosahexaenoic acid | HMDB |
| C24:6n-3 | LIPID MAPS |
| C24:6ω-3 | ChEBI |
| all-cis-tetracosa-6,9,12,15,18,21-hexaenoic acid | ChEBI |
| Nisinic acid | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| HMDB0013025 | HMDB |
| LMFA01030822 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7539663 | Reaxys |
| Citations |
|---|