EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H44NO7 |
| Net Charge | +1 |
| Average Mass | 470.627 |
| Monoisotopic Mass | 470.31123 |
| SMILES | C[C@@H]1C[C@H]([NH+](C)C)[C@@H](O)[C@H](O[C@H]2[C@@H](C)C[C@@H](C)C(=O)/C=C/[C@@H](C)[C@@H]([C@@H](C)O)OC(=O)[C@@H]2C)O1 |
| InChI | InChI=1S/C25H43NO7/c1-13-9-10-20(28)14(2)11-15(3)22(17(5)24(30)32-23(13)18(6)27)33-25-21(29)19(26(7)8)12-16(4)31-25/h9-10,13-19,21-23,25,27,29H,11-12H2,1-8H3/p+1/b10-9+/t13-,14-,15+,16-,17-,18-,19+,21-,22+,23+,25+/m1/s1 |
| InChIKey | UEIVQYHYALXCBD-OTUJEKPESA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| neomethymycin(1+) (CHEBI:77353) is a ammonium ion derivative (CHEBI:35274) |
| neomethymycin(1+) (CHEBI:77353) is a organic cation (CHEBI:25697) |
| neomethymycin(1+) (CHEBI:77353) is conjugate acid of neomethymycin (CHEBI:29656) |
| Incoming Relation(s) |
| neomethymycin (CHEBI:29656) is conjugate base of neomethymycin(1+) (CHEBI:77353) |
| IUPAC Name |
|---|
| (3R,4S,5S,7R,9E,11R,12S)-12-[(1R)-1-hydroxyethyl]-3,5,7,11-tetramethyl-2,8-dioxooxacyclododec-9-en-4-yl 3,4,6-trideoxy-3-(dimethylazaniumyl)-β-D-xylo-hexopyranoside |
| UniProt Name | Source |
|---|---|
| neomethymycin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-13833 | MetaCyc |
| Citations |
|---|