EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H43NO7 |
| Net Charge | 0 |
| Average Mass | 469.619 |
| Monoisotopic Mass | 469.30395 |
| SMILES | C[C@@H]1C[C@H](N(C)C)[C@@H](O)[C@H](O[C@H]2[C@@H](C)C[C@@H](C)C(=O)/C=C/[C@@H](C)[C@@H]([C@@H](C)O)OC(=O)[C@@H]2C)O1 |
| InChI | InChI=1S/C25H43NO7/c1-13-9-10-20(28)14(2)11-15(3)22(17(5)24(30)32-23(13)18(6)27)33-25-21(29)19(26(7)8)12-16(4)31-25/h9-10,13-19,21-23,25,27,29H,11-12H2,1-8H3/b10-9+/t13-,14-,15+,16-,17-,18-,19+,21-,22+,23+,25+/m1/s1 |
| InChIKey | UEIVQYHYALXCBD-OTUJEKPESA-N |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| neomethymycin (CHEBI:29656) has role bacterial metabolite (CHEBI:76969) |
| neomethymycin (CHEBI:29656) is a enone (CHEBI:51689) |
| neomethymycin (CHEBI:29656) is a macrolide antibiotic (CHEBI:25105) |
| neomethymycin (CHEBI:29656) is a monosaccharide derivative (CHEBI:63367) |
| neomethymycin (CHEBI:29656) is conjugate base of neomethymycin(1+) (CHEBI:77353) |
| Incoming Relation(s) |
| neomethymycin(1+) (CHEBI:77353) is conjugate acid of neomethymycin (CHEBI:29656) |
| IUPAC Name |
|---|
| (3R,4S,5S,7R,9E,11R,12S)-12-[(1R)-1-hydroxyethyl]-3,5,7,11-tetramethyl-2,8-dioxooxacyclododec-9-en-4-yl 3,4,6-trideoxy-3-(dimethylamino)-β-D-xylo-hexopyranoside |
| Manual Xrefs | Databases |
|---|---|
| C11995 | KEGG COMPOUND |
| LMPK04000036 | LIPID MAPS |
| CPD-13833 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1334300 | Reaxys |
| CAS:497-73-4 | KEGG COMPOUND |
| CAS:497-73-4 | ChemIDplus |
| Citations |
|---|