EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | 2C22H27FN3O6S.Ca |
| Net Charge | 0 |
| Average Mass | 1001.154 |
| Monoisotopic Mass | 1000.28351 |
| SMILES | CC(C)c1nc(N(C)S(C)(=O)=O)nc(-c2ccc(F)cc2)c1/C=C/[C@@H](O)C[C@@H](O)CC(=O)[O-].CC(C)c1nc(N(C)S(C)(=O)=O)nc(-c2ccc(F)cc2)c1/C=C/[C@@H](O)C[C@@H](O)CC(=O)[O-].[Ca+2] |
| InChI | InChI=1S/2C22H28FN3O6S.Ca/c2*1-13(2)20-18(10-9-16(27)11-17(28)12-19(29)30)21(14-5-7-15(23)8-6-14)25-22(24-20)26(3)33(4,31)32;/h2*5-10,13,16-17,27-28H,11-12H2,1-4H3,(H,29,30);/q;;+2/p-2/b2*10-9+;/t2*16-,17-;/m11./s1 |
| InChIKey | LALFOYNTGMUKGG-BGRFNVSISA-L |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | CETP inhibitor Any inhibitor of cholesterylester transfer protein (CETP), which transfers cholesterol from high density lipoproteins (HDL, the 'good' cholesterol-containing particles) to low or very low density lipoproteins (LDL or VLDL, the 'bad' cholesterol-containing particles). Inhibition of this process results in higher HDL levels and lower LDL levels. CETP inhibitors are under investigation as potential drugs to reduce the risk of arteriosclerotic vascular disease (atherosclerosis). |
| Applications: | cardioprotective agent Any protective agent that is able to prevent damage to the heart. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rosuvastatin calcium (CHEBI:77249) has part rosuvastatin(1−) (CHEBI:77313) |
| rosuvastatin calcium (CHEBI:77249) has role anti-inflammatory agent (CHEBI:67079) |
| rosuvastatin calcium (CHEBI:77249) has role cardioprotective agent (CHEBI:77307) |
| rosuvastatin calcium (CHEBI:77249) has role CETP inhibitor (CHEBI:49205) |
| rosuvastatin calcium (CHEBI:77249) is a N-acyl-15-methylhexadecasphinganine-1-phosphoethanolamine (CHEBI:83765) |
| rosuvastatin calcium (CHEBI:77249) is a organic calcium salt (CHEBI:51031) |
| IUPAC Name |
|---|
| calcium bis[(3R,5S,6E)-7-{4-(4-fluorophenyl)-6-isopropyl-2-[methyl(methylsulfonyl)amino]pyrimidin-5-yl}-3,5-dihydroxyhept-6-enoate] |
| Synonyms | Source |
|---|---|
| Rosuvastatin hemicalcium | ChemIDplus |
| ZD 4522 | KEGG DRUG |
| Brand Name | Source |
|---|---|
| Crestor | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D01915 | KEGG DRUG |
| DB01098 | DrugBank |
| EP2298745 | Patent |
| HMDB0015230 | HMDB |
| Rosuvastatin | Wikipedia |
| WO2008015563 | Patent |
| WO2012002741 | Patent |
| WO2012016479 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7740139 | Reaxys |
| CAS:147098-20-2 | KEGG DRUG |
| CAS:147098-20-2 | ChemIDplus |
| Citations |
|---|