EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | 2C22H27FN3O6S.Ca |
| Net Charge | 0 |
| Average Mass | 1001.154 |
| Monoisotopic Mass | 1000.28351 |
| SMILES | CC(C)c1nc(N(C)S(C)(=O)=O)nc(-c2ccc(F)cc2)c1/C=C/[C@@H](O)C[C@@H](O)CC(=O)[O-].CC(C)c1nc(N(C)S(C)(=O)=O)nc(-c2ccc(F)cc2)c1/C=C/[C@@H](O)C[C@@H](O)CC(=O)[O-].[Ca+2] |
| InChI | InChI=1S/2C22H28FN3O6S.Ca/c2*1-13(2)20-18(10-9-16(27)11-17(28)12-19(29)30)21(14-5-7-15(23)8-6-14)25-22(24-20)26(3)33(4,31)32;/h2*5-10,13,16-17,27-28H,11-12H2,1-4H3,(H,29,30);/q;;+2/p-2/b2*10-9+;/t2*16-,17-;/m11./s1 |
| InChIKey | LALFOYNTGMUKGG-BGRFNVSISA-L |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | CETP inhibitor Any inhibitor of cholesterylester transfer protein (CETP), which transfers cholesterol from high density lipoproteins (HDL, the 'good' cholesterol-containing particles) to low or very low density lipoproteins (LDL or VLDL, the 'bad' cholesterol-containing particles). Inhibition of this process results in higher HDL levels and lower LDL levels. CETP inhibitors are under investigation as potential drugs to reduce the risk of arteriosclerotic vascular disease (atherosclerosis). anti-HBV agent An antiviral agent that destroys or inhibits the replication of the hepatitis B virus. |
| Applications: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. antiatherosclerotic agent A cardiovascular drug that prevents atherosclerosis (a disease in which the inside of an artery narrows due to the build up of plaque). Compare with antiatherogenic agent. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. cardioprotective agent Any protective agent that is able to prevent damage to the heart. anti-inflammatory agent Any compound that has anti-inflammatory effects. hypoglycemic agent A drug which lowers the blood glucose level. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. anticholesteremic drug A substance used to lower plasma cholesterol levels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rosuvastatin calcium (CHEBI:77249) has part rosuvastatin(1−) (CHEBI:77313) |
| rosuvastatin calcium (CHEBI:77249) has role anti-HBV agent (CHEBI:64951) |
| rosuvastatin calcium (CHEBI:77249) has role anti-inflammatory agent (CHEBI:67079) |
| rosuvastatin calcium (CHEBI:77249) has role antiatherosclerotic agent (CHEBI:145947) |
| rosuvastatin calcium (CHEBI:77249) has role anticholesteremic drug (CHEBI:35821) |
| rosuvastatin calcium (CHEBI:77249) has role antihypertensive agent (CHEBI:35674) |
| rosuvastatin calcium (CHEBI:77249) has role antineoplastic agent (CHEBI:35610) |
| rosuvastatin calcium (CHEBI:77249) has role cardioprotective agent (CHEBI:77307) |
| rosuvastatin calcium (CHEBI:77249) has role cardiovascular drug (CHEBI:35554) |
| rosuvastatin calcium (CHEBI:77249) has role CETP inhibitor (CHEBI:49205) |
| rosuvastatin calcium (CHEBI:77249) has role hypoglycemic agent (CHEBI:35526) |
| rosuvastatin calcium (CHEBI:77249) is a N-acyl-15-methylhexadecasphinganine-1-phosphoethanolamine (CHEBI:83765) |
| rosuvastatin calcium (CHEBI:77249) is a organic calcium salt (CHEBI:51031) |
| IUPAC Name |
|---|
| calcium bis[(3R,5S,6E)-7-{4-(4-fluorophenyl)-6-isopropyl-2-[methyl(methylsulfonyl)amino]pyrimidin-5-yl}-3,5-dihydroxyhept-6-enoate] |
| Synonyms | Source |
|---|---|
| Fortius | ChEMBL |
| NSC-747274 | ChEMBL |
| NSC-758930 | ChEMBL |
| Rostar | ChEMBL |
| Rosuvastatin (as calcium) | ChEMBL |
| Rosuvastatin calcium salt | ChEMBL |
| Brand Names | Source |
|---|---|
| Crestor | KEGG DRUG |
| Ezallor | ChEMBL |
| Ezallor sprinkle | ChEMBL |
| Rosuvastatin calcium component of roszet | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| D01915 | KEGG DRUG |
| DB01098 | DrugBank |
| EP2298745 | Patent |
| HMDB0015230 | HMDB |
| Rosuvastatin | Wikipedia |
| WO2008015563 | Patent |
| WO2012002741 | Patent |
| WO2012016479 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7740139 | Reaxys |
| CAS:147098-20-2 | KEGG DRUG |
| CAS:147098-20-2 | ChemIDplus |
| Citations |
|---|