EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H30N3 |
| Net Charge | +1 |
| Average Mass | 372.536 |
| Monoisotopic Mass | 372.24342 |
| SMILES | CN(C)c1ccc(C(=C2C=CC(=[N+](C)C)C=C2)c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C25H30N3/c1-26(2)22-13-7-19(8-14-22)25(20-9-15-23(16-10-20)27(3)4)21-11-17-24(18-12-21)28(5)6/h7-18H,1-6H3/q+1 |
| InChIKey | LGLFFNDHMLKUMI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| crystal violet cation (CHEBI:77181) has role antibacterial agent (CHEBI:33282) |
| crystal violet cation (CHEBI:77181) has role antifungal agent (CHEBI:35718) |
| crystal violet cation (CHEBI:77181) is a iminium ion (CHEBI:35286) |
| Incoming Relation(s) |
| crystal violet (CHEBI:41688) has part crystal violet cation (CHEBI:77181) |
| IUPAC Name |
|---|
| 4-{bis[4-(dimethylamino)phenyl]methylene}-N,N-dimethylcyclohexa-2,5-dien-1-iminium |
| Synonyms | Source |
|---|---|
| gentian violet(1+) | ChEBI |
| crystal violet(1+) | ChEBI |
| crystal violet ion(1) | ChemIDplus |
| gentian violet cation | ChemIDplus |
| gentian violet carbocation | ChEBI |
| crystal violet carbocation | ChEBI |