EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H30N3.Cl |
| Net Charge | 0 |
| Average Mass | 407.989 |
| Monoisotopic Mass | 407.21283 |
| SMILES | CN(C)c1ccc(C(=C2C=CC(=[N+](C)C)C=C2)c2ccc(N(C)C)cc2)cc1.[Cl-] |
| InChI | InChI=1S/C25H30N3.ClH/c1-26(2)22-13-7-19(8-14-22)25(20-9-15-23(16-10-20)27(3)4)21-11-17-24(18-12-21)28(5)6;/h7-18H,1-6H3;1H/q+1;/p-1 |
| InChIKey | ZXJXZNDDNMQXFV-UHFFFAOYSA-M |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Applications: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. antiseptic drug A substance used locally on humans and other animals to destroy harmful microorganisms or to inhibit their activity (cf. disinfectants, which destroy microorganisms found on non-living objects, and antibiotics, which can be transported through the lymphatic system to destroy bacteria within the body). anthelminthic drug Substance intended to kill parasitic worms (helminths). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| crystal violet (CHEBI:41688) has part crystal violet cation (CHEBI:77181) |
| crystal violet (CHEBI:41688) has role anthelminthic drug (CHEBI:35443) |
| crystal violet (CHEBI:41688) has role antibacterial agent (CHEBI:33282) |
| crystal violet (CHEBI:41688) has role antifungal agent (CHEBI:35718) |
| crystal violet (CHEBI:41688) has role antiseptic drug (CHEBI:48218) |
| crystal violet (CHEBI:41688) has role histological dye (CHEBI:77178) |
| crystal violet (CHEBI:41688) is a organic chloride salt (CHEBI:36094) |
| IUPAC Name |
|---|
| 4-{bis[4-(dimethylamino)phenyl]methylene}-N,N-dimethylcyclohexa-2,5-dien-1-iminium chloride |
| INNs | Source |
|---|---|
| chlorure de méthylrosanilinium | WHO MedNet |
| cloruro de metilrosanilina | WHO MedNet |
| methylrosanilinii chloridum | WHO MedNet |
| methylrosanilinium chloride | WHO MedNet |
| Synonyms | Source |
|---|---|
| (4-{bis[-(dimethylamino)phenyl]methylene}-2,5-cyclohexadien-1-ylidene)dimethylammonium chloride | ChemIDplus |
| aniline violet | ChemIDplus |
| Basic Violet 3 | ChemIDplus |
| Basic Violet BN | ChemIDplus |
| Bismuth Violet | ChemIDplus |
| Blaues pyoktanin | ChemIDplus |
| Brand Names | Source |
|---|---|
| Adergon | ChemIDplus |
| Atmonil | ChemIDplus |
| Avermin | ChemIDplus |
| Axuris | ChemIDplus |
| Badil | ChemIDplus |
| Gentiaverm | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Crystal_violet | Wikipedia |
| CVI | PDBeChem |
| D01046 | KEGG DRUG |
| DB00406 | DrugBank |
| HMDB0014550 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3580948 | Reaxys |
| CAS:548-62-9 | ChemIDplus |
| Citations |
|---|