EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H30N3.Cl |
| Net Charge | 0 |
| Average Mass | 407.989 |
| Monoisotopic Mass | 407.21283 |
| SMILES | CN(C)c1ccc(C(=C2C=CC(=[N+](C)C)C=C2)c2ccc(N(C)C)cc2)cc1.[Cl-] |
| InChI | InChI=1S/C25H30N3.ClH/c1-26(2)22-13-7-19(8-14-22)25(20-9-15-23(16-10-20)27(3)4)21-11-17-24(18-12-21)28(5)6;/h7-18H,1-6H3;1H/q+1;/p-1 |
| InChIKey | ZXJXZNDDNMQXFV-UHFFFAOYSA-M |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Applications: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. anthelminthic drug Substance intended to kill parasitic worms (helminths). antiseptic drug A substance used locally on humans and other animals to destroy harmful microorganisms or to inhibit their activity (cf. disinfectants, which destroy microorganisms found on non-living objects, and antibiotics, which can be transported through the lymphatic system to destroy bacteria within the body). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| crystal violet (CHEBI:41688) has part crystal violet cation (CHEBI:77181) |
| crystal violet (CHEBI:41688) has role anthelminthic drug (CHEBI:35443) |
| crystal violet (CHEBI:41688) has role antibacterial agent (CHEBI:33282) |
| crystal violet (CHEBI:41688) has role antifungal agent (CHEBI:35718) |
| crystal violet (CHEBI:41688) has role antiseptic drug (CHEBI:48218) |
| crystal violet (CHEBI:41688) has role histological dye (CHEBI:77178) |
| crystal violet (CHEBI:41688) is a organic chloride salt (CHEBI:36094) |
| IUPAC Name |
|---|
| 4-{bis[4-(dimethylamino)phenyl]methylene}-N,N-dimethylcyclohexa-2,5-dien-1-iminium chloride |
| INNs | Source |
|---|---|
| chlorure de méthylrosanilinium | WHO MedNet |
| cloruro de metilrosanilina | WHO MedNet |
| methylrosanilinii chloridum | WHO MedNet |
| methylrosanilinium chloride | WHO MedNet |
| Synonyms | Source |
|---|---|
| (4-{bis[-(dimethylamino)phenyl]methylene}-2,5-cyclohexadien-1-ylidene)dimethylammonium chloride | ChemIDplus |
| aniline violet | ChemIDplus |
| Basic Violet 3 | ChemIDplus |
| Basic Violet BN | ChemIDplus |
| Bismuth Violet | ChemIDplus |
| Blaues pyoktanin | ChemIDplus |
| Brand Names | Source |
|---|---|
| Adergon | ChemIDplus |
| Atmonil | ChemIDplus |
| Avermin | ChemIDplus |
| Axuris | ChemIDplus |
| Badil | ChemIDplus |
| Gentiaverm | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Crystal_violet | Wikipedia |
| CVI | PDBeChem |
| D01046 | KEGG DRUG |
| DB00406 | DrugBank |
| HMDB0014550 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3580948 | Reaxys |
| CAS:548-62-9 | ChemIDplus |
| Citations |
|---|