EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H22O12 |
| Net Charge | 0 |
| Average Mass | 358.296 |
| Monoisotopic Mass | 358.11113 |
| SMILES | O=C(O)[C@H](O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)[C@H](O)CO |
| WURCS | WURCS=2.0/2,2,1/[A2122h][a2122h-1b_1-5]/1-2/a4-b1 |
| InChI | InChI=1S/C12H22O12/c13-1-3(15)10(7(18)8(19)11(21)22)24-12-9(20)6(17)5(16)4(2-14)23-12/h3-10,12-20H,1-2H2,(H,21,22)/t3-,4-,5-,6+,7-,8-,9-,10-,12+/m1/s1 |
| InChIKey | JYTUSYBCFIZPBE-ZNLUKOTNSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cellobionic acid (CHEBI:77021) has functional parent cellobiose (CHEBI:17057) |
| cellobionic acid (CHEBI:77021) has role metabolite (CHEBI:25212) |
| cellobionic acid (CHEBI:77021) is a carbohydrate acid (CHEBI:33720) |
| cellobionic acid (CHEBI:77021) is a disaccharide (CHEBI:36233) |
| cellobionic acid (CHEBI:77021) is conjugate acid of cellobionate (CHEBI:76825) |
| Incoming Relation(s) |
| cellobionate (CHEBI:76825) is conjugate base of cellobionic acid (CHEBI:77021) |
| IUPAC Name |
|---|
| β-D-glucopyranosyl-(1→4)-D-gluconic acid |
| Synonyms | Source |
|---|---|
| 4-O-β-D-glucopyranosyl-D-gluconic acid | IUPAC |
| 4-O-β-D-glucosyl-D-gluconic acid | ChEBI |
| Maltobionic acid | ChemIDplus |
| β-D-glucosyl-(1→4)-D-gluconic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:95054 | Reaxys |
| CAS:534-41-8 | ChemIDplus |
| Citations |
|---|