EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:17057 - cellobiose
| Formula | C12H22O11 |
| Net Charge | 0 |
| Average Mass | 342.297 |
| Monoisotopic Mass | 342.11621 |
| SMILES | OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O |
| WURCS | WURCS=2.0/2,2,1/[a2122h-1x_1-5][a2122h-1b_1-5]/1-2/a4-b1 |
| InChI | InChI=1S/C12H22O11/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17/h3-20H,1-2H2/t3-,4-,5-,6+,7-,8-,9-,10-,11?,12+/m1/s1 |
| InChIKey | GUBGYTABKSRVRQ-CUHNMECISA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cellobiose (CHEBI:17057) has role plant metabolite (CHEBI:76924) |
| cellobiose (CHEBI:17057) is a glycosylglucose (CHEBI:24405) |
| Incoming Relation(s) |
| 3-O-β-D-glucosyl-D-glucuronic acid (CHEBI:77025) has functional parent cellobiose (CHEBI:17057) |
| 6-phospho-β-D-glucosyl-(1→4)-D-glucose (CHEBI:17888) has functional parent cellobiose (CHEBI:17057) |
| cellobionic acid (CHEBI:77021) has functional parent cellobiose (CHEBI:17057) |
| β-D-Glcp-(1→6)-β-D-Glcp-(1→4)-D-Glcp (CHEBI:148000) has functional parent cellobiose (CHEBI:17057) |
| α-cellobiose (CHEBI:28676) is a cellobiose (CHEBI:17057) |
| β-cellobiose (CHEBI:36217) is a cellobiose (CHEBI:17057) |
| IUPAC Name |
|---|
| β-D-glucopyranosyl-(1→4)-D-glucopyranose |
| Synonyms | Source |
|---|---|
| Cellobiose | KEGG COMPOUND |
| 1-beta-D-Glucopyranosyl-4-D-glucopyranose | KEGG COMPOUND |
| D-glucosyl-β-(1-4)-D-glucose | ChemIDplus |
| 4-(β-D-glucosido)-D-glucose | ChemIDplus |
| 4-O-β-D-glucopyranosyl-D-glucopyranose | IUPAC |
| 4-β-D-glucopyranosyl-D-glucopyranose | ChemIDplus |
| UniProt Name | Source |
|---|---|
| D-cellobiose | UniProt |
| Citations |
|---|