EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H11N5 |
| Net Charge | 0 |
| Average Mass | 213.244 |
| Monoisotopic Mass | 213.10145 |
| SMILES | Cc1cnc2ccc3c(nc(N)n3C)c2n1 |
| InChI | InChI=1S/C11H11N5/c1-6-5-13-7-3-4-8-10(9(7)14-6)15-11(12)16(8)2/h3-5H,1-2H3,(H2,12,15) |
| InChIKey | DVCCCQNKIYNAKB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Maillard reaction product Any thermal degradation product obtained as a result of a chemical reaction between an amino acid and a reducing sugar (Maillard reaction, a non-enzymatic browning procedure that usually imparts flavour to starch-based food products). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. genotoxin A role played by a chemical compound to induce direct or indirect DNA damage. Such damage can potentially lead to the formation of a malignant tumour, but DNA damage does not lead inevitably to the creation of cancerous cells. mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| MeIQx (CHEBI:76604) has role carcinogenic agent (CHEBI:50903) |
| MeIQx (CHEBI:76604) has role genotoxin (CHEBI:50902) |
| MeIQx (CHEBI:76604) has role Maillard reaction product (CHEBI:77523) |
| MeIQx (CHEBI:76604) has role mutagen (CHEBI:25435) |
| MeIQx (CHEBI:76604) is a aromatic amine (CHEBI:33860) |
| MeIQx (CHEBI:76604) is a imidazoquinoxaline (CHEBI:76605) |
| Incoming Relation(s) |
| N-hydroxy-MeIQx (CHEBI:133915) has functional parent MeIQx (CHEBI:76604) |
| IUPAC Name |
|---|
| 3,8-dimethyl-3H-imidazo[4,5-f]quinoxalin-2-amine |
| Synonyms | Source |
|---|---|
| 2-Amino-3,8-dimethyl-3H-imidazo(4,5-f)quinoxaline | ChemIDplus |
| 2-Amino-3,8-dimethylimidazo[4,5-f]quinoxaline | KEGG COMPOUND |
| 8-MeIQX | ChemIDplus |
| 8-Methyl-IQX | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C19255 | KEGG COMPOUND |
| HMDB0029864 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4188271 | Reaxys |
| CAS:77500-04-0 | ChemIDplus |
| CAS:77500-04-0 | KEGG COMPOUND |
| Citations |
|---|