EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H11N5 |
| Net Charge | 0 |
| Average Mass | 213.244 |
| Monoisotopic Mass | 213.10145 |
| SMILES | Cc1cnc2ccc3c(nc(N)n3C)c2n1 |
| InChI | InChI=1S/C11H11N5/c1-6-5-13-7-3-4-8-10(9(7)14-6)15-11(12)16(8)2/h3-5H,1-2H3,(H2,12,15) |
| InChIKey | DVCCCQNKIYNAKB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Maillard reaction product Any thermal degradation product obtained as a result of a chemical reaction between an amino acid and a reducing sugar (Maillard reaction, a non-enzymatic browning procedure that usually imparts flavour to starch-based food products). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. genotoxin A role played by a chemical compound to induce direct or indirect DNA damage. Such damage can potentially lead to the formation of a malignant tumour, but DNA damage does not lead inevitably to the creation of cancerous cells. carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| MeIQx (CHEBI:76604) has role carcinogenic agent (CHEBI:50903) |
| MeIQx (CHEBI:76604) has role genotoxin (CHEBI:50902) |
| MeIQx (CHEBI:76604) has role Maillard reaction product (CHEBI:77523) |
| MeIQx (CHEBI:76604) has role mutagen (CHEBI:25435) |
| MeIQx (CHEBI:76604) is a aromatic amine (CHEBI:33860) |
| MeIQx (CHEBI:76604) is a imidazoquinoxaline (CHEBI:76605) |
| Incoming Relation(s) |
| N-hydroxy-MeIQx (CHEBI:133915) has functional parent MeIQx (CHEBI:76604) |
| IUPAC Name |
|---|
| 3,8-dimethyl-3H-imidazo[4,5-f]quinoxalin-2-amine |
| Synonyms | Source |
|---|---|
| 2-Amino-3,8-dimethyl-3H-imidazo(4,5-f)quinoxaline | ChemIDplus |
| 2-Amino-3,8-dimethylimidazo[4,5-f]quinoxaline | KEGG COMPOUND |
| 8-MeIQX | ChemIDplus |
| 8-Methyl-IQX | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C19255 | KEGG COMPOUND |
| HMDB0029864 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4188271 | Reaxys |
| CAS:77500-04-0 | ChemIDplus |
| CAS:77500-04-0 | KEGG COMPOUND |
| Citations |
|---|