EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:133915 - N-hydroxy-MeIQx
| Formula | C11H11N5O |
| Net Charge | 0 |
| Average Mass | 229.243 |
| Monoisotopic Mass | 229.09636 |
| SMILES | Cc1cnc2ccc3c(nc(NO)n3C)c2n1 |
| InChI | InChI=1S/C11H11N5O/c1-6-5-12-7-3-4-8-10(9(7)13-6)14-11(15-17)16(8)2/h3-5,17H,1-2H3,(H,14,15) |
| InChIKey | FVNCCTJGBOTWTM-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Apis cerana (ncbitaxon:7461) | - | MetaboLights (MTBLS379) | |
| Homo Sapiens (ncbitaxon:9606) | urine (BTO:0001419) | PubMed (10503894) | |
| Rattus norvegicus (ncbitaxon:10116) | - | PubMed (11453738) |
| Roles Classification |
|---|
| Chemical Roles: | nitric oxide donor An agent, with unique chemical structure and biochemical requirements, which generates nitric oxide. nucleophilic reagent A reagent that forms a bond to its reaction partner (the electrophile) by donating both bonding electrons. |
| Biological Roles: | mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. genotoxin A role played by a chemical compound to induce direct or indirect DNA damage. Such damage can potentially lead to the formation of a malignant tumour, but DNA damage does not lead inevitably to the creation of cancerous cells. rat metabolite Any mammalian metabolite produced during a metabolic reaction in rat (Rattus norvegicus). EC 1.1.3.13 (alcohol oxidase) inhibitor An EC 1.1.3.* (oxidoreductase acting on donor CH-OH group, oxygen as acceptor) inhibitor that interferes with the action of alcohol oxidase (EC 1.1.3.13). bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. EC 4.2.1.22 (cystathionine beta-synthase) inhibitor An EC 4.2.1.* (hydro-lyases) inhibitor that interferes with the action of cystathionine β-synthase (EC 4.2.1.22). EC 4.3.1.10 (serine-sulfate ammonia-lyase) inhibitor An EC 4.3.1.* (ammonia-lyase) inhibitor that interferes with the action of serine-sulfate ammonia-lyase (EC 4.3.1.10). |
| Application: | nucleophilic reagent A reagent that forms a bond to its reaction partner (the electrophile) by donating both bonding electrons. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-hydroxy-MeIQx (CHEBI:133915) has functional parent MeIQx (CHEBI:76604) |
| N-hydroxy-MeIQx (CHEBI:133915) has role carcinogenic agent (CHEBI:50903) |
| N-hydroxy-MeIQx (CHEBI:133915) has role genotoxin (CHEBI:50902) |
| N-hydroxy-MeIQx (CHEBI:133915) has role human urinary metabolite (CHEBI:84087) |
| N-hydroxy-MeIQx (CHEBI:133915) has role human xenobiotic metabolite (CHEBI:76967) |
| N-hydroxy-MeIQx (CHEBI:133915) has role mutagen (CHEBI:25435) |
| N-hydroxy-MeIQx (CHEBI:133915) has role rat metabolite (CHEBI:86264) |
| N-hydroxy-MeIQx (CHEBI:133915) is a hydroxylamine (CHEBI:15429) |
| N-hydroxy-MeIQx (CHEBI:133915) is a imidazoquinoxaline (CHEBI:76605) |
| IUPAC Name |
|---|
| N-(3,8-dimethyl-1,3-dihydro-2H-imidazo[4,5-f]quinoxalin-2-ylidene)hydroxylamine |
| Synonyms | Source |
|---|---|
| 2-hydroxyamino-3,8-dimethylimidazo[4,5-f]quinoxaline | ChEBI |
| 3,8-dimethyl-1,3-dihydro-2H-imidazo(4,5-f)quinoxalin-2-one oxime | ChemIDplus |
| N-hydroxy-methyl-IQX | ChemIDplus |
| N-OH-MeIQx | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C20291 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8146608 | Reaxys |
| CAS:115044-41-2 | ChemIDplus |
| CAS:115044-41-2 | KEGG COMPOUND |
| Citations |
|---|