EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H32O9 |
| Net Charge | 0 |
| Average Mass | 464.511 |
| Monoisotopic Mass | 464.20463 |
| SMILES | [H][C@@]12CCc3cc(O)ccc3[C@@]1([H])CC[C@]1(C)[C@@H](O)[C@H](O[C@@H]3O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]3O)C[C@@]21[H] |
| InChI | InChI=1S/C24H32O9/c1-24-7-6-13-12-5-3-11(25)8-10(12)2-4-14(13)15(24)9-16(21(24)29)32-23-19(28)17(26)18(27)20(33-23)22(30)31/h3,5,8,13-21,23,25-29H,2,4,6-7,9H2,1H3,(H,30,31)/t13-,14-,15+,16-,17+,18+,19-,20+,21+,23-,24+/m1/s1 |
| InChIKey | FQYGGFDZJFIDPU-JRSYHJKYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | PubMed (2994907) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Role: | human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| estriol 16-O-(β-D-glucuronide) (CHEBI:766) has functional parent estriol (CHEBI:27974) |
| estriol 16-O-(β-D-glucuronide) (CHEBI:766) has role human urinary metabolite (CHEBI:84087) |
| estriol 16-O-(β-D-glucuronide) (CHEBI:766) is a 17β-hydroxy steroid (CHEBI:35343) |
| estriol 16-O-(β-D-glucuronide) (CHEBI:766) is a 3-hydroxy steroid (CHEBI:36834) |
| estriol 16-O-(β-D-glucuronide) (CHEBI:766) is a phenols (CHEBI:33853) |
| estriol 16-O-(β-D-glucuronide) (CHEBI:766) is a steroid glucosiduronic acid (CHEBI:26763) |
| estriol 16-O-(β-D-glucuronide) (CHEBI:766) is a β-D-glucosiduronic acid (CHEBI:15341) |
| estriol 16-O-(β-D-glucuronide) (CHEBI:766) is conjugate acid of estriol 16-O-(β-D-glucuronide)(1−) (CHEBI:136650) |
| Incoming Relation(s) |
| estriol 16-O-(β-D-glucuronide)(1−) (CHEBI:136650) is conjugate base of estriol 16-O-(β-D-glucuronide) (CHEBI:766) |
| IUPAC Name |
|---|
| 3,17β-dihydroxyestra-1,3,5(10)-trien-16α-yl β-D-glucopyranosiduronic acid |
| Synonyms | Source |
|---|---|
| 16-Glucuronide-estriol | KEGG COMPOUND |
| 16alpha,17beta-Estriol 16-(beta-D-glucuronide) | KEGG COMPOUND |
| Estriol-16-glucosiduronate | ChemIDplus |
| Oestriol-16alpha-glucuronide | ChemIDplus |
| Estriol-16alpha-glucuronide | ChemIDplus |
| 16α,17β-estriol 16-O-(β-D-glucuronide) | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C05504 | KEGG COMPOUND |
| LMST05010008 | LIPID MAPS |
| HMDB0006766 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:67674 | Reaxys |
| CAS:1852-50-2 | KEGG COMPOUND |
| CAS:1852-50-2 | ChemIDplus |
| Citations |
|---|