EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H9ClN2 |
| Net Charge | +2 |
| Average Mass | 144.605 |
| Monoisotopic Mass | 144.04433 |
| SMILES | [NH3+]c1ccc([NH3+])c(Cl)c1 |
| InChI | InChI=1S/C6H7ClN2/c7-5-3-4(8)1-2-6(5)9/h1-3H,8-9H2/p+2 |
| InChIKey | MGLZGLAFFOMWPB-UHFFFAOYSA-P |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-chloro-1,4-phenylenediaminium (CHEBI:76599) is a ammonium ion derivative (CHEBI:35274) |
| 2-chloro-1,4-phenylenediaminium (CHEBI:76599) is a organic cation (CHEBI:25697) |
| 2-chloro-1,4-phenylenediaminium (CHEBI:76599) is conjugate acid of 2-chloro-1,4-phenylenediamine (CHEBI:76598) |
| Incoming Relation(s) |
| 2-chloro-1,4-phenylenediamine sulfate (CHEBI:76597) has part 2-chloro-1,4-phenylenediaminium (CHEBI:76599) |
| 2-chloro-1,4-phenylenediamine (CHEBI:76598) is conjugate base of 2-chloro-1,4-phenylenediaminium (CHEBI:76599) |
| IUPAC Name |
|---|
| 2-chlorobenzene-1,4-diaminium |
| Synonyms | Source |
|---|---|
| 2-chloro-p-phenylenediaminium | ChEBI |
| 2-chloro-1,4-phenylenediaminium(2+) | ChEBI |
| 2-chloro-p-phenylenediaminium(2+) | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8441373 | Reaxys |