EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H7ClN2 |
| Net Charge | 0 |
| Average Mass | 142.589 |
| Monoisotopic Mass | 142.02978 |
| SMILES | Nc1ccc(N)c(Cl)c1 |
| InChI | InChI=1S/C6H7ClN2/c7-5-3-4(8)1-2-6(5)9/h1-3H,8-9H2 |
| InChIKey | MGLZGLAFFOMWPB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-chloro-1,4-phenylenediamine (CHEBI:76598) has functional parent 1,4-phenylenediamine (CHEBI:51403) |
| 2-chloro-1,4-phenylenediamine (CHEBI:76598) has role dye (CHEBI:37958) |
| 2-chloro-1,4-phenylenediamine (CHEBI:76598) is a diamine (CHEBI:23666) |
| 2-chloro-1,4-phenylenediamine (CHEBI:76598) is a monochlorobenzenes (CHEBI:83403) |
| 2-chloro-1,4-phenylenediamine (CHEBI:76598) is conjugate base of 2-chloro-1,4-phenylenediaminium (CHEBI:76599) |
| Incoming Relation(s) |
| 2-chloro-1,4-phenylenediaminium (CHEBI:76599) is conjugate acid of 2-chloro-1,4-phenylenediamine (CHEBI:76598) |
| IUPAC Name |
|---|
| 2-chlorobenzene-1,4-diamine |
| Synonyms | Source |
|---|---|
| 1,4-Diamino-2-chlorobenzene | ChemIDplus |
| 2-Chloro-1,4-benzenediamine | ChemIDplus |
| 2-Chloro-1,4-diaminobenzene | ChemIDplus |
| 2-Chloro-4-phenylenediamine | ChemIDplus |
| 2-Chloro-p-phenylenediamine | ChemIDplus |
| 3-Chloro-4-aminoaniline | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2802557 | Reaxys |
| CAS:615-66-7 | ChemIDplus |
| Citations |
|---|