EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H46O2 |
| Net Charge | 0 |
| Average Mass | 402.663 |
| Monoisotopic Mass | 402.34978 |
| SMILES | [H][C@@]12CC=C3C[C@@H](O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@H](C)CCC[C@@H](C)CO |
| InChI | InChI=1S/C27H46O2/c1-18(17-28)6-5-7-19(2)23-10-11-24-22-9-8-20-16-21(29)12-14-26(20,3)25(22)13-15-27(23,24)4/h8,18-19,21-25,28-29H,5-7,9-17H2,1-4H3/t18-,19-,21+,22+,23-,24+,25+,26+,27-/m1/s1 |
| InChIKey | FYHRJWMENCALJY-YSQMORBQSA-N |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). EC 3.1.1.1 (carboxylesterase) inhibitor Any EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that inhibits the action of carboxylesterase (EC 3.1.1.1 ). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| Application: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (25R)-cholest-5-ene-3β,26-diol (CHEBI:76591) has functional parent cholesterol (CHEBI:16113) |
| (25R)-cholest-5-ene-3β,26-diol (CHEBI:76591) has role apoptosis inducer (CHEBI:68495) |
| (25R)-cholest-5-ene-3β,26-diol (CHEBI:76591) has role human metabolite (CHEBI:77746) |
| (25R)-cholest-5-ene-3β,26-diol (CHEBI:76591) has role mouse metabolite (CHEBI:75771) |
| (25R)-cholest-5-ene-3β,26-diol (CHEBI:76591) has role neuroprotective agent (CHEBI:63726) |
| (25R)-cholest-5-ene-3β,26-diol (CHEBI:76591) is a 26-hydroxycholesterol (CHEBI:17703) |
| Incoming Relation(s) |
| (25R)-3β-hydroxycholest-5-en-26-al (CHEBI:86096) has functional parent (25R)-cholest-5-ene-3β,26-diol (CHEBI:76591) |
| IUPAC Name |
|---|
| (3β,25R)-cholest-5-ene-3,26-diol |
| Synonyms | Source |
|---|---|
| Cholest-5-ene-3beta,27-diol | ChemIDplus |
| 5-cholestene-3beta,27-diol | ChemIDplus |
| (25R)-Cholest-5-ene-3beta,26-diol | ChemIDplus |
| 27-Hydroxycholesterol | ChemIDplus |
| (25R)-26-hydroxycholesterol | ChEBI |
| (25R)-cholest-5-ene-3β,26-diol | ChEBI |
| UniProt Name | Source |
|---|---|
| (25R)-cholest-5-ene-3β,26-diol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| HMDB0002103 | HMDB |
| CPD-7287 | MetaCyc |
| FDB022846 | FooDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3161261 | Reaxys |
| CAS:20380-11-4 | ChemIDplus |
| Citations |
|---|