EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H46O2 |
| Net Charge | 0 |
| Average Mass | 402.663 |
| Monoisotopic Mass | 402.34978 |
| SMILES | [H][C@@]12CC=C3C[C@@H](O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@H](C)CCCC(C)CO |
| InChI | InChI=1S/C27H46O2/c1-18(17-28)6-5-7-19(2)23-10-11-24-22-9-8-20-16-21(29)12-14-26(20,3)25(22)13-15-27(23,24)4/h8,18-19,21-25,28-29H,5-7,9-17H2,1-4H3/t18?,19-,21+,22+,23-,24+,25+,26+,27-/m1/s1 |
| InChIKey | FYHRJWMENCALJY-CCDZVGGQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). EC 3.1.1.1 (carboxylesterase) inhibitor Any EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that inhibits the action of carboxylesterase (EC 3.1.1.1 ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 26-hydroxycholesterol (CHEBI:17703) has functional parent cholesterol (CHEBI:16113) |
| 26-hydroxycholesterol (CHEBI:17703) has role EC 3.1.1.1 (carboxylesterase) inhibitor (CHEBI:78444) |
| 26-hydroxycholesterol (CHEBI:17703) has role human metabolite (CHEBI:77746) |
| 26-hydroxycholesterol (CHEBI:17703) is a 26-hydroxy steroid (CHEBI:36852) |
| 26-hydroxycholesterol (CHEBI:17703) is a 3β-hydroxy-Δ5-steroid (CHEBI:1722) |
| 26-hydroxycholesterol (CHEBI:17703) is a oxysterol (CHEBI:53030) |
| Incoming Relation(s) |
| 26-hydroxycholesterol 3-sulfate (CHEBI:35419) has functional parent 26-hydroxycholesterol (CHEBI:17703) |
| (25R)-cholest-5-ene-3β,26-diol (CHEBI:76591) is a 26-hydroxycholesterol (CHEBI:17703) |
| IUPAC Name |
|---|
| cholest-5-ene-3β,26-diol |
| Synonyms | Source |
|---|---|
| 26-Hydroxycholesterol | KEGG COMPOUND |
| 27-Hydroxycholesterol | KEGG COMPOUND |
| 27-Hydroxycholesterol | KEGG COMPOUND |
| Cholest-5-ene-3beta,26-diol | KEGG COMPOUND |
| Cholest-5-ene-3beta,27-diol | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| 26-hydroxycholesterol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C15610 | KEGG COMPOUND |
| LMST01010057 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4708620 | Beilstein |
| CAS:13095-61-9 | KEGG COMPOUND |
| Citations |
|---|