EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H18ClN7O |
| Net Charge | 0 |
| Average Mass | 311.777 |
| Monoisotopic Mass | 311.12614 |
| SMILES | N=C(N)NC(=O)c1nc(Cl)c(N2CCCCCC2)nc1N |
| InChI | InChI=1S/C12H18ClN7O/c13-8-10(20-5-3-1-2-4-6-20)18-9(14)7(17-8)11(21)19-12(15)16/h1-6H2,(H2,14,18)(H4,15,16,19,21) |
| InChIKey | RQQJJXVETXFINY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | sodium channel blocker An agent that inhibits sodium influx through cell membranes. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. odorant receptor antagonist An antagonist at the odorant receptor. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-(N,N-hexamethylene)amiloride (CHEBI:76400) has functional parent amiloride (CHEBI:2639) |
| 5-(N,N-hexamethylene)amiloride (CHEBI:76400) has role antineoplastic agent (CHEBI:35610) |
| 5-(N,N-hexamethylene)amiloride (CHEBI:76400) has role apoptosis inducer (CHEBI:68495) |
| 5-(N,N-hexamethylene)amiloride (CHEBI:76400) has role odorant receptor antagonist (CHEBI:76531) |
| 5-(N,N-hexamethylene)amiloride (CHEBI:76400) has role sodium channel blocker (CHEBI:38633) |
| 5-(N,N-hexamethylene)amiloride (CHEBI:76400) is a aromatic amine (CHEBI:33860) |
| 5-(N,N-hexamethylene)amiloride (CHEBI:76400) is a azepanes (CHEBI:46986) |
| 5-(N,N-hexamethylene)amiloride (CHEBI:76400) is a guanidines (CHEBI:24436) |
| 5-(N,N-hexamethylene)amiloride (CHEBI:76400) is a monocarboxylic acid amide (CHEBI:29347) |
| 5-(N,N-hexamethylene)amiloride (CHEBI:76400) is a organochlorine compound (CHEBI:36683) |
| 5-(N,N-hexamethylene)amiloride (CHEBI:76400) is a pyrazines (CHEBI:38314) |
| IUPAC Name |
|---|
| 3-amino-5-(azepan-1-yl)-N-carbamimidoyl-6-chloropyrazine-2-carboxamide |
| Synonyms | Source |
|---|---|
| 3-Amino-6-chloro-5-(1-homopiperidyl)-N-(diaminomethylene)pyrazinecarboxamide | ChemIDplus |
| Hexamethylene amiloride | ChemIDplus |
| Hexamethyleneamiloride | ChemIDplus |
| HMA | SUBMITTER |
| HMA-5 | ChemIDplus |
| Citations |
|---|