EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H18ClN7O |
| Net Charge | 0 |
| Average Mass | 311.777 |
| Monoisotopic Mass | 311.12614 |
| SMILES | N=C(N)NC(=O)c1nc(Cl)c(N2CCCCCC2)nc1N |
| InChI | InChI=1S/C12H18ClN7O/c13-8-10(20-5-3-1-2-4-6-20)18-9(14)7(17-8)11(21)19-12(15)16/h1-6H2,(H2,14,18)(H4,15,16,19,21) |
| InChIKey | RQQJJXVETXFINY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | sodium channel blocker An agent that inhibits sodium influx through cell membranes. odorant receptor antagonist An antagonist at the odorant receptor. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-(N,N-hexamethylene)amiloride (CHEBI:76400) has functional parent amiloride (CHEBI:2639) |
| 5-(N,N-hexamethylene)amiloride (CHEBI:76400) has role antineoplastic agent (CHEBI:35610) |
| 5-(N,N-hexamethylene)amiloride (CHEBI:76400) has role apoptosis inducer (CHEBI:68495) |
| 5-(N,N-hexamethylene)amiloride (CHEBI:76400) has role odorant receptor antagonist (CHEBI:76531) |
| 5-(N,N-hexamethylene)amiloride (CHEBI:76400) has role sodium channel blocker (CHEBI:38633) |
| 5-(N,N-hexamethylene)amiloride (CHEBI:76400) is a aromatic amine (CHEBI:33860) |
| 5-(N,N-hexamethylene)amiloride (CHEBI:76400) is a azepanes (CHEBI:46986) |
| 5-(N,N-hexamethylene)amiloride (CHEBI:76400) is a guanidines (CHEBI:24436) |
| 5-(N,N-hexamethylene)amiloride (CHEBI:76400) is a monocarboxylic acid amide (CHEBI:29347) |
| 5-(N,N-hexamethylene)amiloride (CHEBI:76400) is a organochlorine compound (CHEBI:36683) |
| 5-(N,N-hexamethylene)amiloride (CHEBI:76400) is a pyrazines (CHEBI:38314) |
| IUPAC Name |
|---|
| 3-amino-5-(azepan-1-yl)-N-carbamimidoyl-6-chloropyrazine-2-carboxamide |
| Synonyms | Source |
|---|---|
| 3-Amino-6-chloro-5-(1-homopiperidyl)-N-(diaminomethylene)pyrazinecarboxamide | ChemIDplus |
| Hexamethylene amiloride | ChemIDplus |
| Hexamethyleneamiloride | ChemIDplus |
| HMA | SUBMITTER |
| HMA-5 | ChemIDplus |
| Citations |
|---|