EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12O5 |
| Net Charge | 0 |
| Average Mass | 224.212 |
| Monoisotopic Mass | 224.06847 |
| SMILES | COc1cc(/C=C\C(=O)O)cc(OC)c1O |
| InChI | InChI=1S/C11H12O5/c1-15-8-5-7(3-4-10(12)13)6-9(16-2)11(8)14/h3-6,14H,1-2H3,(H,12,13)/b4-3- |
| InChIKey | PCMORTLOPMLEFB-ARJAWSKDSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cis-sinapic acid (CHEBI:76350) has role plant metabolite (CHEBI:76924) |
| cis-sinapic acid (CHEBI:76350) is a sinapic acid (CHEBI:77131) |
| Incoming Relation(s) |
| N-cis-sinapoyltyramine (CHEBI:234326) has functional parent cis-sinapic acid (CHEBI:76350) |
| IUPAC Name |
|---|
| (2Z)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoic acid |
| Synonyms | Source |
|---|---|
| (Z)-4-hydroxy-3,5-dimethoxycinnamic acid | ChEBI |
| cis-4-hydroxy-3,5-dimethoxycinnamic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| HMDB0034069 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3034336 | Reaxys |
| CAS:7361-90-2 | HMDB |