EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H21NO5 |
| Net Charge | 0 |
| Average Mass | 343.379 |
| Monoisotopic Mass | 343.14197 |
| SMILES | COc1cc(/C=C\C(=O)NCCc2ccc(O)cc2)cc(OC)c1O |
| InChI | InChI=1S/C19H21NO5/c1-24-16-11-14(12-17(25-2)19(16)23)5-8-18(22)20-10-9-13-3-6-15(21)7-4-13/h3-8,11-12,21,23H,9-10H2,1-2H3,(H,20,22)/b8-5- |
| InChIKey | IEDBNTAKVGBZEP-YVMONPNESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Corydalis racemosa (ncbitaxon:54431) | whole plant (BTO:0001461) | PubMed (32495600) | |
| Illigera luzonensis (ncbitaxon:74946) | Root (BTO:0001188) | DOI (10.1016/j.phytochem.2010.12.015) | |
| Lindera glauca (ncbitaxon:332435) | aerial part (BTO:0001658) | DOI (10.1002/jccs.200100116) | |
| Piper puberulum (ncbitaxon:511550) | - | PubMed (33822610) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-cis-sinapoyltyramine (CHEBI:234326) has functional parent cis-sinapic acid (CHEBI:76350) |
| N-cis-sinapoyltyramine (CHEBI:234326) has role plant metabolite (CHEBI:76924) |
| N-cis-sinapoyltyramine (CHEBI:234326) is a N-sinapoyltyramine (CHEBI:234327) |
| IUPAC Name |
|---|
| (2Z)-3-(4-hydroxy-3,5-dimethoxyphenyl)-N-[2-(4-hydroxyphenyl)ethyl]prop-2-enamide |
| Synonyms | Source |
|---|---|
| N-(4-hydroxyphenethyl)-3,5-dimethoxy-4-hydroxy-cis-cinnamamide | ChEBI |
| N-[(Z)-sinapoyl]tyramine | ChEBI |
| cis-N-sinapoyltyramine | ChEBI |
| (Z)-3-(4-hydroxy-3,5-dimethoxyphenyl)-N-[2-(4-hydroxyphenyl)ethyl]prop-2-enamide | ChEBI |
| Citations |
|---|