EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H10O5 |
| Net Charge | 0 |
| Average Mass | 258.229 |
| Monoisotopic Mass | 258.05282 |
| SMILES | Cc1cc(O)cc2oc3cc(O)cc(O)c3c(=O)c12 |
| InChI | InChI=1S/C14H10O5/c1-6-2-7(15)4-10-12(6)14(18)13-9(17)3-8(16)5-11(13)19-10/h2-5,15-17H,1H3 |
| InChIKey | AQZHBCDRWFMXIN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Wardomyces anomalus (ncbitaxon:186366) | - | DOI (10.1021/np020518b) |
| Roles Classification |
|---|
| Biological Roles: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| Application: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| norlichexanthone (CHEBI:7632) has role antimalarial (CHEBI:38068) |
| norlichexanthone (CHEBI:7632) has role fungal metabolite (CHEBI:76946) |
| norlichexanthone (CHEBI:7632) is a polyphenol (CHEBI:26195) |
| norlichexanthone (CHEBI:7632) is a xanthones (CHEBI:51149) |
| norlichexanthone (CHEBI:7632) is conjugate acid of norlichexanthone(1−) (CHEBI:193063) |
| Incoming Relation(s) |
| norlichexanthone(1−) (CHEBI:193063) is conjugate base of norlichexanthone (CHEBI:7632) |
| IUPAC Name |
|---|
| 1,3,6-trihydroxy-8-methyl-9H-xanthen-9-one |
| Synonym | Source |
|---|---|
| 1,3,6-Trihydroxy-8-methyl-9H-xanthen-9-one | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:259778 | Reaxys |
| CAS:20716-98-7 | ChemIDplus |
| CAS:20716-98-7 | KEGG COMPOUND |
| Citations |
|---|