EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H10O5 |
| Net Charge | 0 |
| Average Mass | 258.229 |
| Monoisotopic Mass | 258.05282 |
| SMILES | Cc1cc(O)cc2oc3cc(O)cc(O)c3c(=O)c12 |
| InChI | InChI=1S/C14H10O5/c1-6-2-7(15)4-10-12(6)14(18)13-9(17)3-8(16)5-11(13)19-10/h2-5,15-17H,1H3 |
| InChIKey | AQZHBCDRWFMXIN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Wardomyces anomalus (ncbitaxon:186366) | - | DOI (10.1021/np020518b) |
| Roles Classification |
|---|
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| Application: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| norlichexanthone (CHEBI:7632) has role antimalarial (CHEBI:38068) |
| norlichexanthone (CHEBI:7632) has role fungal metabolite (CHEBI:76946) |
| norlichexanthone (CHEBI:7632) is a polyphenol (CHEBI:26195) |
| norlichexanthone (CHEBI:7632) is a xanthones (CHEBI:51149) |
| norlichexanthone (CHEBI:7632) is conjugate acid of norlichexanthone(1−) (CHEBI:193063) |
| Incoming Relation(s) |
| norlichexanthone(1−) (CHEBI:193063) is conjugate base of norlichexanthone (CHEBI:7632) |
| IUPAC Name |
|---|
| 1,3,6-trihydroxy-8-methyl-9H-xanthen-9-one |
| Synonym | Source |
|---|---|
| 1,3,6-Trihydroxy-8-methyl-9H-xanthen-9-one | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:259778 | Reaxys |
| CAS:20716-98-7 | KEGG COMPOUND |
| CAS:20716-98-7 | ChemIDplus |
| Citations |
|---|