EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H9O5 |
| Net Charge | -1 |
| Average Mass | 257.221 |
| Monoisotopic Mass | 257.04555 |
| SMILES | Cc1cc([O-])cc2oc3cc(O)cc(O)c3c(=O)c12 |
| InChI | InChI=1S/C14H10O5/c1-6-2-7(15)4-10-12(6)14(18)13-9(17)3-8(16)5-11(13)19-10/h2-5,15-17H,1H3/p-1 |
| InChIKey | AQZHBCDRWFMXIN-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| norlichexanthone(1−) (CHEBI:193063) is a organic anion (CHEBI:25696) |
| norlichexanthone(1−) (CHEBI:193063) is conjugate base of norlichexanthone (CHEBI:7632) |
| Incoming Relation(s) |
| norlichexanthone (CHEBI:7632) is conjugate acid of norlichexanthone(1−) (CHEBI:193063) |
| UniProt Name | Source |
|---|---|
| norlichexanthone | UniProt |
| Citations |
|---|