EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H26O4 |
| Net Charge | 0 |
| Average Mass | 258.358 |
| Monoisotopic Mass | 258.18311 |
| SMILES | O=C(O)CCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C14H26O4/c15-13(16)11-9-7-5-3-1-2-4-6-8-10-12-14(17)18/h1-12H2,(H,15,16)(H,17,18) |
| InChIKey | HQHCYKULIHKCEB-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (3183053) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tetradecanedioic acid (CHEBI:76308) has parent hydride tetradecane (CHEBI:41253) |
| tetradecanedioic acid (CHEBI:76308) has role human metabolite (CHEBI:77746) |
| tetradecanedioic acid (CHEBI:76308) is a dicarboxylic fatty acid (CHEBI:189840) |
| tetradecanedioic acid (CHEBI:76308) is a α,ω-dicarboxylic acid (CHEBI:28383) |
| tetradecanedioic acid (CHEBI:76308) is conjugate acid of tetradecanedioate(2−) (CHEBI:76281) |
| Incoming Relation(s) |
| (3S)-hydroxytetradecanedioyl-CoA (CHEBI:77169) has functional parent tetradecanedioic acid (CHEBI:76308) |
| tetradecanedioyl-CoA (CHEBI:77207) has functional parent tetradecanedioic acid (CHEBI:76308) |
| tetradecanedioate(2−) (CHEBI:76281) is conjugate base of tetradecanedioic acid (CHEBI:76308) |
| IUPAC Name |
|---|
| tetradecanedioic acid |
| Synonyms | Source |
|---|---|
| 1,12-Dodecanedicarboxylic acid | ChemIDplus |
| 1,14-Tetradecanedioic acid | HMDB |
| Dodecamethylenedicarboxylic acid | HMDB |
| NSC 9504 | ChemIDplus |
| Tetradecane-1,14-dioic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| EP0296506 | Patent |
| HMDB0000872 | HMDB |
| LMFA01170018 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1788202 | Reaxys |
| CAS:821-38-5 | ChemIDplus |
| Citations |
|---|