EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H24O4 |
| Net Charge | -2 |
| Average Mass | 256.342 |
| Monoisotopic Mass | 256.16856 |
| SMILES | O=C([O-])CCCCCCCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C14H26O4/c15-13(16)11-9-7-5-3-1-2-4-6-8-10-12-14(17)18/h1-12H2,(H,15,16)(H,17,18)/p-2 |
| InChIKey | HQHCYKULIHKCEB-UHFFFAOYSA-L |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (21886157) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tetradecanedioate(2−) (CHEBI:76281) has role human metabolite (CHEBI:77746) |
| tetradecanedioate(2−) (CHEBI:76281) is a dicarboxylic acid dianion (CHEBI:28965) |
| tetradecanedioate(2−) (CHEBI:76281) is a saturated dicarboxylic acid dianion(2−) (CHEBI:133291) |
| tetradecanedioate(2−) (CHEBI:76281) is conjugate base of tetradecanedioic acid (CHEBI:76308) |
| Incoming Relation(s) |
| tetradecanedioic acid (CHEBI:76308) is conjugate acid of tetradecanedioate(2−) (CHEBI:76281) |
| IUPAC Name |
|---|
| tetradecanedioate |
| Synonym | Source |
|---|---|
| C14-DCA(2−) | SUBMITTER |
| UniProt Name | Source |
|---|---|
| tetradecanedioate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3670966 | Reaxys |