EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22O2 |
| Net Charge | 0 |
| Average Mass | 282.383 |
| Monoisotopic Mass | 282.16198 |
| SMILES | C[C@H](C(=O)O)c1ccc(C2CCCCC2)c2ccccc12 |
| InChI | InChI=1S/C19H22O2/c1-13(19(20)21)15-11-12-16(14-7-3-2-4-8-14)18-10-6-5-9-17(15)18/h5-6,9-14H,2-4,7-8H2,1H3,(H,20,21)/t13-/m0/s1 |
| InChIKey | VZUGVMQFWFVFBX-ZDUSSCGKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-vedaprofen (CHEBI:76286) is a 2-(4-cyclohexyl-1-naphthyl)propanoic acid (CHEBI:76284) |
| (S)-vedaprofen (CHEBI:76286) is enantiomer of (R)-vedaprofen (CHEBI:76285) |
| Incoming Relation(s) |
| vedaprofen (CHEBI:32292) has part (S)-vedaprofen (CHEBI:76286) |
| (R)-vedaprofen (CHEBI:76285) is enantiomer of (S)-vedaprofen (CHEBI:76286) |
| IUPAC Name |
|---|
| (2S)-2-(4-cyclohexyl-1-naphthyl)propanoic acid |
| Synonym | Source |
|---|---|
| (S)-4-cyclohexyl-α-methyl-1-naphthaleneacetic acid | ChEBI |