EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H13F4NO2 |
| Net Charge | 0 |
| Average Mass | 327.277 |
| Monoisotopic Mass | 327.08824 |
| SMILES | CCc1ccc(Nc2c(F)c(F)cc(F)c2F)c(CC(=O)O)c1 |
| InChI | InChI=1S/C16H13F4NO2/c1-2-8-3-4-12(9(5-8)6-13(22)23)21-16-14(19)10(17)7-11(18)15(16)20/h3-5,7,21H,2,6H2,1H3,(H,22,23) |
| InChIKey | ZEXGDYFACFXQPF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | cyclooxygenase 2 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 2. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| Applications: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| robenacoxib (CHEBI:76269) has role cyclooxygenase 2 inhibitor (CHEBI:50629) |
| robenacoxib (CHEBI:76269) has role non-narcotic analgesic (CHEBI:35481) |
| robenacoxib (CHEBI:76269) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| robenacoxib (CHEBI:76269) is a aromatic amino acid (CHEBI:33856) |
| robenacoxib (CHEBI:76269) is a monocarboxylic acid (CHEBI:25384) |
| robenacoxib (CHEBI:76269) is a organofluorine compound (CHEBI:37143) |
| robenacoxib (CHEBI:76269) is a phenylacetic acids (CHEBI:25978) |
| robenacoxib (CHEBI:76269) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| {5-ethyl-2-[(2,3,5,6-tetrafluorophenyl)amino]phenyl}acetic acid |
| INNs | Source |
|---|---|
| robenacoxib | ChemIDplus |
| robenacoxibum | WHO MedNet |
| robénacoxib | WHO MedNet |
| robenacoxib | WHO MedNet |
| Manual Xrefs | Databases |
|---|---|
| US6291523 | Patent |
| Robenacoxib | Wikipedia |
| 3002 | VSDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:13748212 | Reaxys |
| CAS:220991-32-2 | ChemIDplus |
| Citations |
|---|