EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H22O4 |
| Net Charge | 0 |
| Average Mass | 302.370 |
| Monoisotopic Mass | 302.15181 |
| SMILES | CC(Cc1ccc(O)c(O)c1)C(C)Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C18H22O4/c1-11(7-13-3-5-15(19)17(21)9-13)12(2)8-14-4-6-16(20)18(22)10-14/h3-6,9-12,19-22H,7-8H2,1-2H3 |
| InChIKey | HCZKYJDFEPMADG-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | ferroptosis inhibitor Any substance that inhibits the process of ferroptosis (a type of programmed cell death dependent on iron and characterized by the accumulation of lipid peroxides) in organisms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nordihydroguaiaretic acid (CHEBI:7625) has role antioxidant (CHEBI:22586) |
| nordihydroguaiaretic acid (CHEBI:7625) has role ferroptosis inhibitor (CHEBI:173084) |
| nordihydroguaiaretic acid (CHEBI:7625) has role geroprotector (CHEBI:176497) |
| nordihydroguaiaretic acid (CHEBI:7625) has role plant metabolite (CHEBI:76924) |
| nordihydroguaiaretic acid (CHEBI:7625) is a catechols (CHEBI:33566) |
| nordihydroguaiaretic acid (CHEBI:7625) is a lignan (CHEBI:25036) |
| nordihydroguaiaretic acid (CHEBI:7625) is a tetrol (CHEBI:33573) |
| Incoming Relation(s) |
| masoprocol (CHEBI:73468) is a nordihydroguaiaretic acid (CHEBI:7625) |
| IUPAC Name |
|---|
| 4,4'-(2,3-dimethylbutane-1,4-diyl)dibenzene-1,2-diol |
| Synonyms | Source |
|---|---|
| β,γ-dimethyl-α,δ-bis(3,4-dihydroxyphenyl)butane | ChemIDplus |
| norhydroguaiaretic acid | ChemIDplus |
| nordihydroguaiaretic acid | ChemIDplus |
| NDGA | ChemIDplus |
| 2,3-bis(3,4-dihydroxyphenylmethyl)butane | NIST Chemistry WebBook |
| NSC 4291 | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| C10719 | KEGG COMPOUND |
| Nordihydroguaiaretic_acid | Wikipedia |
| CPD-7661 | MetaCyc |
| HMDB0012270 | HMDB |
| LSM-6507 | LINCS |
| Citations |
|---|