EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H22O4 |
| Net Charge | 0 |
| Average Mass | 302.370 |
| Monoisotopic Mass | 302.15181 |
| SMILES | C[C@H](Cc1ccc(O)c(O)c1)[C@@H](C)Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C18H22O4/c1-11(7-13-3-5-15(19)17(21)9-13)12(2)8-14-4-6-16(20)18(22)10-14/h3-6,9-12,19-22H,7-8H2,1-2H3/t11-,12+ |
| InChIKey | HCZKYJDFEPMADG-TXEJJXNPSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. lipoxygenase inhibitor A compound or agent that combines with lipoxygenase and thereby prevents its substrate-enzyme combination with arachidonic acid and the formation of the icosanoid products hydroxyicosatetraenoic acid and various leukotrienes. ferroptosis inhibitor Any substance that inhibits the process of ferroptosis (a type of programmed cell death dependent on iron and characterized by the accumulation of lipid peroxides) in organisms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | hypoglycemic agent A drug which lowers the blood glucose level. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| masoprocol (CHEBI:73468) has role antineoplastic agent (CHEBI:35610) |
| masoprocol (CHEBI:73468) has role hypoglycemic agent (CHEBI:35526) |
| masoprocol (CHEBI:73468) has role lipoxygenase inhibitor (CHEBI:35856) |
| masoprocol (CHEBI:73468) has role metabolite (CHEBI:25212) |
| masoprocol (CHEBI:73468) is a nordihydroguaiaretic acid (CHEBI:7625) |
| IUPAC Name |
|---|
| 4-[(2R,3S)-4-(3,4-dihydroxyphenyl)-2,3-dimethylbutyl]benzene-1,2-diol |
| INNs | Source |
|---|---|
| masoprocol | ChemIDplus |
| masoprocol | WHO MedNet |
| masoprocolum | ChemIDplus |
| masoprocol | WHO MedNet |
| Synonyms | Source |
|---|---|
| meso-nordihydroguaiaretic acid | KEGG DRUG |
| meso-4-[4-(3,4-dihydroxyphenyl)-2,3-dimethylbutyl]benzene-1,2-diol | ChEBI |
| CHX 100 | ChemIDplus |
| erythro-nordihydroguaiaretic acid | ChEBI |
| meso-NDGA | ChEBI |
| CHX-100 | ChemIDplus |
| Brand Name | Source |
|---|---|
| Actinex | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D04862 | KEGG DRUG |
| Masoprocol | Wikipedia |
| DB00179 | DrugBank |
| HMDB0014325 | HMDB |
| C10719 | KEGG COMPOUND |
| C00000693 | KNApSAcK |
| 1637 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9874298 | Reaxys |
| Reaxys:2056826 | Reaxys |
| CAS:27686-84-6 | ChemIDplus |
| CAS:500-38-9 | KEGG COMPOUND |
| Citations |
|---|