EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H7O3 |
| Net Charge | -1 |
| Average Mass | 127.119 |
| Monoisotopic Mass | 127.04007 |
| SMILES | Cc1oc(C)c(O)c1[O-] |
| InChI | InChI=1S/C6H8O3/c1-3-5(7)6(8)4(2)9-3/h7-8H,1-2H3/p-1 |
| InChIKey | IIGLVVZHSDZGOL-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxy-2,5-dimethylfuran-3-olate (CHEBI:76248) is a organic anion (CHEBI:25696) |
| 4-hydroxy-2,5-dimethylfuran-3-olate (CHEBI:76248) is conjugate base of 4-hydroxy-2,5-dimethylfuran-3-one (CHEBI:76247) |
| Incoming Relation(s) |
| 4-hydroxy-2,5-dimethylfuran-3-one (CHEBI:76247) is conjugate acid of 4-hydroxy-2,5-dimethylfuran-3-olate (CHEBI:76248) |
| IUPAC Name |
|---|
| 4-hydroxy-2,5-dimethylfuran-3-olate |
| UniProt Name | Source |
|---|---|
| 4-hydroxy-2,5-dimethylfuran-3(2H)-olate | UniProt |